1.0 2010-04-08 22:11:33 UTC 2025-11-19 00:50:51 UTC FDB014926 Menthofuran (r)-menthofuran, also known as 4,5,6,7-tetrahydro-3,6-dimethylbenzofuran or 3,9-epoxy-P-mentha-3,8-diene, is a member of the class of compounds known as aromatic monoterpenoids. Aromatic monoterpenoids are monoterpenoids containing at least one aromatic ring (r)-menthofuran is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). (r)-menthofuran is a coffee, earthy, and musty tasting compound found in herbs and spices, mentha (mint), and orange mint, which makes (r)-menthofuran a potential biomarker for the consumption of these food products (r)-menthofuran can be found primarily in saliva. 3,9-Epoxy-p-mentha-3,8-diene 4,5,6,7-Tetrahydro-3,6-dimethylbenzofuran, 9CI FEMA 3235 C10H14O 150.2176 150.10446507 3,6-dimethyl-4,5,6,7-tetrahydro-1-benzofuran 3,9-epoxy-p-mentha-3,8-diene 494-90-6 CC1CCC2=C(C1)OC=C2C InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h6-7H,3-5H2,1-2H3 YGWKXXYGDYYFJU-UHFFFAOYSA-N belongs to the class of organic compounds known as aromatic monoterpenoids. These are monoterpenoids containing at least one aromatic ring. Aromatic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aromatic heteropolycyclic compounds Benzofurans Bicyclic monoterpenoids Furans Heteroaromatic compounds Hydrocarbon derivatives Organooxygen compounds Oxacyclic compounds Aromatic heteropolycyclic compound Aromatic monoterpenoid Benzofuran Bicyclic monoterpenoid Furan Heteroaromatic compound Hydrocarbon derivative Menthofuran monoterpenoid Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle 1-benzofurans Iridoids Menthane monoterpenoids a monoterpenoid monoterpenoid logp 3.98 ALOGPS logs -3.31 ALOGPS solubility 7.28e-02 g/l ALOGPS logp 3.13 ChemAxon pka_strongest_basic -1.4 ChemAxon iupac 3,6-dimethyl-4,5,6,7-tetrahydro-1-benzofuran ChemAxon average_mass 150.2176 ChemAxon mono_mass 150.10446507 ChemAxon smiles CC1CCC2=C(C1)OC=C2C ChemAxon formula C10H14O ChemAxon inchi InChI=1S/C10H14O/c1-7-3-4-9-8(2)6-11-10(9)5-7/h6-7H,3-5H2,1-2H3 ChemAxon inchikey YGWKXXYGDYYFJU-UHFFFAOYSA-N ChemAxon polar_surface_area 13.14 ChemAxon refractivity 45.67 ChemAxon polarizability 18.04 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7086 Specdb::MsIr 7087 Specdb::CMs 18606 Specdb::CMs 29084 Specdb::CMs 101783 Specdb::CMs 134166 Specdb::CMs 141900 Specdb::MsMs 7337 Specdb::MsMs 7338 Specdb::MsMs 7339 Specdb::MsMs 12614 Specdb::MsMs 12615 Specdb::MsMs 12616 Specdb::MsMs 14009 Specdb::MsMs 14010 Specdb::MsMs 14011 Specdb::MsMs 19286 Specdb::MsMs 19287 Specdb::MsMs 19288 Specdb::MsMs 2288022 Specdb::MsMs 2288023 Specdb::MsMs 2288024 Specdb::MsMs 2646990 Specdb::MsMs 2646991 Specdb::MsMs 2646992 HMDB0036089 Cornmint Type 1 specific Mentha arvensis 292239 421.6 840.0 3.2 mg/100 g Mentha Type 1 specific Mentha 21819 Orange mint Type 1 specific Mentha aquatica 190902 203.85 380.6 27.1 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 110.0 110.0 110.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 366.85 728.5 5.2 mg/100 g Calcium antagonist 748 Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. Hepatotoxic 984 A role played by a chemical compound exihibiting itself through the ability to induce damage to the liver in animals. Nematicide 1141 A substance used to destroy pests of the phylum Nematoda (roundworms). Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. Pulmonotoxic 1274 A role played by the molecular entity or part thereof which causes the development of a pathological process.