1.0 2010-04-08 22:11:36 UTC 2015-07-20 23:13:51 UTC FDB015027 2-(3-Phenylpropyl)pyridine Flavouring ingredient 2-(3-Phenylpropyl)-pyridine alpha-(3-Phenylpropyl)pyridine FEMA 3751 Pyridine, 2-(3-phenylpropyl)- C14H15N 197.2756 197.120449485 2-(3-phenylpropyl)pyridine 2-(3-phenylpropyl)pyridine 2110-18-1 C(CC1=CC=CC=C1)CC1=NC=CC=C1 InChI=1S/C14H15N/c1-2-7-13(8-3-1)9-6-11-14-10-4-5-12-15-14/h1-5,7-8,10,12H,6,9,11H2 JJJPNTQYUJPWGQ-UHFFFAOYSA-N belongs to the class of organic compounds known as pyridines and derivatives. Pyridines and derivatives are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. Pyridines and derivatives Organic compounds Organoheterocyclic compounds Pyridines and derivatives Aromatic heteromonocyclic compounds Azacyclic compounds Benzene and substituted derivatives Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyridine logp 3.88 ALOGPS logs -3.67 ALOGPS solubility 4.20e-02 g/l ALOGPS logp 3.61 ChemAxon pka_strongest_basic 5.59 ChemAxon iupac 2-(3-phenylpropyl)pyridine ChemAxon average_mass 197.2756 ChemAxon mono_mass 197.120449485 ChemAxon smiles C(CC1=CC=CC=C1)CC1=NC=CC=C1 ChemAxon formula C14H15N ChemAxon inchi InChI=1S/C14H15N/c1-2-7-13(8-3-1)9-6-11-14-10-4-5-12-15-14/h1-5,7-8,10,12H,6,9,11H2 ChemAxon inchikey JJJPNTQYUJPWGQ-UHFFFAOYSA-N ChemAxon polar_surface_area 12.89 ChemAxon refractivity 62.42 ChemAxon polarizability 23.24 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7144 Specdb::MsIr 7145 Specdb::CMs 10331 Specdb::CMs 168634 Specdb::MsMs 79863 Specdb::MsMs 79864 Specdb::MsMs 79865 Specdb::MsMs 140568 Specdb::MsMs 140569 Specdb::MsMs 140570 Specdb::MsMs 2227554 Specdb::MsMs 2229572 Specdb::MsMs 2229892 Specdb::MsMs 2231879 Specdb::MsMs 2232335 Specdb::MsMs 2234199 Specdb::MsMs 2234729 Specdb::MsMs 2317370 Specdb::MsMs 2317371 Specdb::MsMs 2317372 Specdb::MsMs 2617589 Specdb::MsMs 2617590 Specdb::MsMs 2617591 HMDB36173 #<Reference:0x000055ce3240e920> cortex fresh green metallic nasturtium weedy