1.0 2010-04-08 22:11:37 UTC 2025-11-19 00:52:07 UTC FDB015046 (±)-5-Hexyldihydro-5-methyl-2(3H)-furanone Flavouring ingredient 2(3H)-Furanone, 5-hexyldihydro-5-methyl- 4-Hydroxy-4-methyldecanoic acid gamma-lactone 4-Methyldecanolide 5-hexyl-5-methyloxolan-2-one 5-Hexyldihydro-5-methyl-2(3H)-furanone 5-Hexyldihydro-5-methylfuran-2(3H)-one Decanoic acid, 4-hydroxy-4-methyl-, gamma-lactone Dihydrojasmone lactone Gamma-methyl decalactone Gamma-methyl-gamma-decanolactone Gamma-methyldecalactone C11H20O2 184.2753 184.146329884 5-hexyl-5-methyloxolan-2-one 5-hexyl-5-methyloxolan-2-one 7011-83-8 CCCCCCC1(C)CCC(=O)O1 InChI=1S/C11H20O2/c1-3-4-5-6-8-11(2)9-7-10(12)13-11/h3-9H2,1-2H3 ALWUKGXLBSQSMA-UHFFFAOYSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Tetrahydrofuran logp 3.73 ALOGPS logs -3.53 ALOGPS solubility 5.43e-02 g/l ALOGPS logp 3.15 ChemAxon pka_strongest_basic -7.1 ChemAxon iupac 5-hexyl-5-methyloxolan-2-one ChemAxon average_mass 184.2753 ChemAxon mono_mass 184.146329884 ChemAxon smiles CCCCCCC1(C)CCC(=O)O1 ChemAxon formula C11H20O2 ChemAxon inchi InChI=1S/C11H20O2/c1-3-4-5-6-8-11(2)9-7-10(12)13-11/h3-9H2,1-2H3 ChemAxon inchikey ALWUKGXLBSQSMA-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 52.29 ChemAxon polarizability 22.22 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7119 Specdb::MsIr 7120 Specdb::CMs 13646 Specdb::CMs 27660 Specdb::CMs 101790 Specdb::CMs 160653 Specdb::MsMs 87663 Specdb::MsMs 87664 Specdb::MsMs 87665 Specdb::MsMs 150216 Specdb::MsMs 150217 Specdb::MsMs 150218 Specdb::MsMs 3046573 Specdb::MsMs 3046574 Specdb::MsMs 3046575 Specdb::MsMs 3094474 Specdb::MsMs 3094475 Specdb::MsMs 3094476 HMDB36140 #<Reference:0x000055ce32ff98c0>