1.0 2010-04-08 22:11:38 UTC 2015-07-20 23:14:40 UTC FDB015080 Cyclohexyl propionate Flavouring ingredient Cyclohexyl n-propionate Cyclohexyl propanoate Cyclohexyl propionate FEMA 2354 Propanoic acid, cyclohexyl ester Propionic acid cyclohexyl ester Propionic acid, cyclohexyl ester C9H16O2 156.2221 156.115029756 cyclohexyl propanoate cyclohexane propionic acid 6222-35-1 CCC(=O)OC1CCCCC1 InChI=1S/C9H16O2/c1-2-9(10)11-8-6-4-3-5-7-8/h8H,2-7H2,1H3 MAMMVUWCKMOLSG-UHFFFAOYSA-N belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). Carboxylic acid esters Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acid derivatives Aliphatic homomonocyclic compounds Carbonyl compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 2.54 ALOGPS logs -2.35 ALOGPS solubility 6.95e-01 g/l ALOGPS logp 2.42 ChemAxon pka_strongest_basic -7 ChemAxon iupac cyclohexyl propanoate ChemAxon average_mass 156.2221 ChemAxon mono_mass 156.115029756 ChemAxon smiles CCC(=O)OC1CCCCC1 ChemAxon formula C9H16O2 ChemAxon inchi InChI=1S/C9H16O2/c1-2-9(10)11-8-6-4-3-5-7-8/h8H,2-7H2,1H3 ChemAxon inchikey MAMMVUWCKMOLSG-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 43.05 ChemAxon polarizability 18.06 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17244 Specdb::CMs 27259 Specdb::CMs 28087 Specdb::CMs 28128 Specdb::CMs 28279 Specdb::CMs 101804 Specdb::CMs 101805 Specdb::CMs 101806 Specdb::CMs 101807 Specdb::CMs 174036 Specdb::MsIr 7207 Specdb::MsIr 7208 Specdb::MsMs 56007 Specdb::MsMs 56008 Specdb::MsMs 56009 Specdb::MsMs 111312 Specdb::MsMs 111313 Specdb::MsMs 111314 Specdb::MsMs 2439445 Specdb::MsMs 2439446 Specdb::MsMs 2439447 Specdb::MsMs 2522859 Specdb::MsMs 2522860 Specdb::MsMs 2522861 HMDB36222 #<Reference:0x000055ce305c3f10> banana fruity green pineapple sweet waxy