1.0 2010-04-08 22:11:44 UTC 2019-11-26 03:11:22 UTC FDB015259 N-cis-Feruloyltyramine Isolated from bell pepper. N-cis-Feruloyltyramine is found in many foods, some of which are cherimoya, yellow bell pepper, green bell pepper, and pepper (c. annuum). N-cis-Feruloyltyramine C18H19NO4 313.3478 313.131408101 (Z,2Z)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propa-2-enimidic acid (Z,2Z)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propa-2-enimidic acid 80510-09-4 COC1=C(O)C=CC(\C=C/C(/O)=N/CCC2=CC=C(O)C=C2)=C1 InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5- NPNNKDMSXVRADT-UITAMQMPSA-N belongs to the class of organic compounds known as hydroxycinnamic acids and derivatives. Hydroxycinnamic acids and derivatives are compounds containing an cinnamic acid (or a derivative thereof) where the benzene ring is hydroxylated. Hydroxycinnamic acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Carbonyl compounds Cinnamic acid amides Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Organonitrogen compounds Organopnictogen compounds Phenoxy compounds Secondary carboxylic acid amides Styrenes 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Cinnamic acid amide Ether Hydrocarbon derivative Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Phenol ether Phenoxy compound Secondary carboxylic acid amide Styrene logp 3.12 ALOGPS logs -4.17 ALOGPS solubility 2.14e-02 g/l ALOGPS logp 3.62 ChemAxon pka_strongest_acidic 7.58 ChemAxon pka_strongest_basic 4.85 ChemAxon iupac (Z,2Z)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]propa-2-enimidic acid ChemAxon average_mass 313.3478 ChemAxon mono_mass 313.131408101 ChemAxon smiles COC1=C(O)C=CC(\C=C/C(/O)=N/CCC2=CC=C(O)C=C2)=C1 ChemAxon formula C18H19NO4 ChemAxon inchi InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5- ChemAxon inchikey NPNNKDMSXVRADT-UITAMQMPSA-N ChemAxon polar_surface_area 82.28 ChemAxon refractivity 90.09 ChemAxon polarizability 33.82 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18981 Specdb::CMs 44845 Specdb::CMs 159006 Specdb::MsMs 85443 Specdb::MsMs 85444 Specdb::MsMs 85445 Specdb::MsMs 147540 Specdb::MsMs 147541 Specdb::MsMs 147542 Specdb::MsMs 2729158 Specdb::MsMs 2729159 Specdb::MsMs 2729160 Specdb::MsMs 2980175 Specdb::MsMs 2980176 Specdb::MsMs 2980177 HMDB36381 #<Reference:0x000055ce2d04e498> Cherimoya Type 1 specific Annona cherimola 49314 Green bell pepper Type 1 specific Capsicum annuum 4072 0.2 0.2 0.2 mg/100 g Herbs and Spices Unknown generic Italian sweet red pepper Type 1 specific Capsicum annuum 4072 Orange bell pepper Type 1 specific Capsicum annuum 4072 0.2 0.2 0.2 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.2 0.2 0.2 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.2 0.2 0.2 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.2 0.2 0.2 mg/100 g