1.0 2010-04-08 22:11:44 UTC 2015-07-20 23:16:06 UTC FDB015265 3-Phenylpropyl cinnamate Flavouring ingredient 2-Propenoic acid, 3-phenyl-, 3-phenylpropyl ester 3-Phenyl-2-propenoic acid 3-phenylpropyl ester 3-Phenylpropyl 3-phenyl-2-propenoate 3-Phenylpropyl beta-phenylacrylate 3-Phenylpropyl cinnamate Cinnamic Acid, 3-phenylpropyl Ester Cinnamic acid, 3-phenylpropyl ester (7CI,8CI) FEMA 2894 Hydrocinnamyl 3-phenylpropenoate Hydrocinnamyl cinnamate Phenylpropyl cinnamate C18H18O2 266.3343 266.13067982 3-phenylpropyl (2E)-3-phenylprop-2-enoate 3-phenylpropyl (2E)-3-phenylprop-2-enoate 122-68-9 O=C(OCCCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 InChI=1S/C18H18O2/c19-18(14-13-17-10-5-2-6-11-17)20-15-7-12-16-8-3-1-4-9-16/h1-6,8-11,13-14H,7,12,15H2/b14-13+ LYRAHIUDQRJGGZ-BUHFOSPRSA-N belongs to the class of organic compounds known as cinnamic acid esters. These are compound containing an ester derivative of cinnamic acid. Cinnamic acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Cinnamic acid esters Aromatic homomonocyclic compounds Carbonyl compounds Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Styrene logp 4.56 ALOGPS logs -5.70 ALOGPS solubility 5.34e-04 g/l ALOGPS logp 4.97 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac 3-phenylpropyl (2E)-3-phenylprop-2-enoate ChemAxon average_mass 266.3343 ChemAxon mono_mass 266.13067982 ChemAxon smiles O=C(OCCCC1=CC=CC=C1)\C=C\C1=CC=CC=C1 ChemAxon formula C18H18O2 ChemAxon inchi InChI=1S/C18H18O2/c19-18(14-13-17-10-5-2-6-11-17)20-15-7-12-16-8-3-1-4-9-16/h1-6,8-11,13-14H,7,12,15H2/b14-13+ ChemAxon inchikey LYRAHIUDQRJGGZ-BUHFOSPRSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 81.8 ChemAxon polarizability 30.78 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26561 Specdb::CMs 136723 Specdb::CMs 144457 Specdb::MsMs 324898 Specdb::MsMs 324899 Specdb::MsMs 324900 Specdb::MsMs 373432 Specdb::MsMs 373433 Specdb::MsMs 373434 Specdb::MsMs 2470503 Specdb::MsMs 2470504 Specdb::MsMs 2470505 Specdb::MsMs 2495021 Specdb::MsMs 2495022 Specdb::MsMs 2495023 HMDB36387 #<Reference:0x000055ce32872638> apricot balsam spicy sweet