1.0 2010-04-08 22:11:48 UTC 2025-11-19 00:54:30 UTC FDB015365 Austricin Austricin is a member of the class of compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Austricin is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Austricin can be found in german camomile and sweet bay, which makes austricin a potential biomarker for the consumption of these food products. 8-Deacetylmatricarin 8-Hydroxy-2-oxo-1(10),3-guaiadien-12,6-olide 8alpha-Hydroxyachillin Austricin Austrisin Deacetoxymatricarin Deacetylmatricarin Deacetylmatricarine Desacetylmatricarin Grossmisine Hydroxyachillin Matricarin, deacetyl- C15H18O4 262.301 262.120509064 4-hydroxy-3,6,9-trimethyl-2H,3H,3aH,4H,5H,7H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione 4-hydroxy-3,6,9-trimethyl-3H,3aH,4H,5H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione 10180-88-8 CC1C2C(OC1=O)C1C(C)=CC(=O)C1=C(C)CC2O InChI=1S/C15H18O4/c1-6-4-10(17)13-8(3)15(18)19-14(13)12-7(2)5-9(16)11(6)12/h5,8,10,12-14,17H,4H2,1-3H3 YMUOZXZDDBRJEP-UHFFFAOYSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteropolycyclic compounds Carboxylic acid esters Hydrocarbon derivatives Ketones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Secondary alcohols Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Ketone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Secondary alcohol Tetrahydrofuran logp 1.02 ALOGPS logs -2.20 ALOGPS solubility 1.67e+00 g/l ALOGPS melting_point Mp 143-146° (double Mp, hydrate) logp 1.12 ChemAxon pka_strongest_acidic 14.58 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac 4-hydroxy-3,6,9-trimethyl-2H,3H,3aH,4H,5H,7H,9aH,9bH-azuleno[4,5-b]furan-2,7-dione ChemAxon average_mass 262.301 ChemAxon mono_mass 262.120509064 ChemAxon smiles CC1C2C(OC1=O)C1C(C)=CC(=O)C1=C(C)CC2O ChemAxon formula C15H18O4 ChemAxon inchi InChI=1S/C15H18O4/c1-6-4-10(17)13-8(3)15(18)19-14(13)12-7(2)5-9(16)11(6)12/h5,8,10,12-14,17H,4H2,1-3H3 ChemAxon inchikey YMUOZXZDDBRJEP-UHFFFAOYSA-N ChemAxon polar_surface_area 63.6 ChemAxon refractivity 70.29 ChemAxon polarizability 27.68 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 49872 Specdb::MsMs 49873 Specdb::MsMs 49874 Specdb::MsMs 115806 Specdb::MsMs 115807 Specdb::MsMs 115808 Specdb::MsMs 3605785 Specdb::MsMs 3605786 Specdb::MsMs 3605787 Specdb::MsMs 3605788 Specdb::MsMs 3605789 Specdb::MsMs 3605790 German camomile Type 1 specific Matricaria recutita 127986 Sweet bay Type 1 specific Laurus nobilis 85223 Allergenic 43 A chemical compound which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy.