1.0 2010-04-08 22:11:49 UTC 2025-11-19 00:54:37 UTC FDB015385 Cumambrin A Cumambrin a belongs to guaianolides and derivatives class of compounds. Those are diterpene lactones with a structure characterized by the presence of a gamma-lactone fused to a guaiane, forming 3,6,9-trimethyl-azuleno[4,5-b]furan-2-one or a derivative. Cumambrin a is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cumambrin a can be found in sweet bay, which makes cumambrin a a potential biomarker for the consumption of this food product. Cumambrin A C17H22O5 306.3536 306.146723814 6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,6H,6aH,7H,9aH,9bH-azuleno[4,5-b]furan-4-yl acetate 6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-3aH,4H,5H,6aH,7H,9aH,9bH-azuleno[4,5-b]furan-4-yl acetate 20482-33-1 CC(=O)OC1CC(C)(O)C2CC=C(C)C2C2OC(=O)C(=C)C12 InChI=1S/C17H22O5/c1-8-5-6-11-13(8)15-14(9(2)16(19)22-15)12(21-10(3)18)7-17(11,4)20/h5,11-15,20H,2,6-7H2,1,3-4H3 XMJROHDIQQOWTO-UHFFFAOYSA-N belongs to the class of organic compounds known as guaianolides and derivatives. These are diterpene lactones with a structure characterized by the presence of a gamma-lactone fused to a guaiane, forming 3,6,9-trimethyl-azuleno[4,5-b]furan-2-one or a derivative. Guaianolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Carbonyl compounds Cyclic alcohols and derivatives Dicarboxylic acids and derivatives Enoate esters Gamma butyrolactones Guaianes Hydrocarbon derivatives Organic oxides Oxacyclic compounds Tertiary alcohols Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Dicarboxylic acid or derivatives Enoate ester Gamma butyrolactone Guaiane sesquiterpenoid Guaianolide-skeleton Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Sesquiterpenoid Tertiary alcohol Tetrahydrofuran logp 1.85 ALOGPS logs -2.33 ALOGPS solubility 1.43e+00 g/l ALOGPS melting_point Mp 188-190° logp 1.07 ChemAxon pka_strongest_acidic 14.67 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac 6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,6H,6aH,7H,9aH,9bH-azuleno[4,5-b]furan-4-yl acetate ChemAxon average_mass 306.3536 ChemAxon mono_mass 306.146723814 ChemAxon smiles CC(=O)OC1CC(C)(O)C2CC=C(C)C2C2OC(=O)C(=C)C12 ChemAxon formula C17H22O5 ChemAxon inchi InChI=1S/C17H22O5/c1-8-5-6-11-13(8)15-14(9(2)16(19)22-15)12(21-10(3)18)7-17(11,4)20/h5,11-15,20H,2,6-7H2,1,3-4H3 ChemAxon inchikey XMJROHDIQQOWTO-UHFFFAOYSA-N ChemAxon polar_surface_area 72.83 ChemAxon refractivity 79.63 ChemAxon polarizability 32.25 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 69312 Specdb::MsMs 69313 Specdb::MsMs 69314 Specdb::MsMs 127566 Specdb::MsMs 127567 Specdb::MsMs 127568 Specdb::MsMs 3605791 Specdb::MsMs 3605792 Specdb::MsMs 3605793 Specdb::MsMs 3605794 Specdb::MsMs 3605795 Specdb::MsMs 3605796 416770 Sweet bay Type 1 specific Laurus nobilis 85223