1.0 2010-04-08 22:11:52 UTC 2025-11-19 00:55:32 UTC FDB015483 Germacrene B Constituent of the peel oil of yuzu Citrus junos. Germacrene B is found in many foods, some of which are pepper (spice), lime, citrus, and common oregano. (1E,4E)-germacra-1(10),4,7(11)-triene (1E,4E)-germacrene B (1E,5E)-8-isopropylidene-1,5-dimethylcyclodeca-1,5-diene (1Z,5Z)-8-Isopropylidene-1,5-dimethylcyclodeca-1,5-diene (E,E)-germacra-1(10),4,7(11)-triene (e,e)-germacrene b Germacratriene Germacrene B Trans,trans-germacrene b C15H24 204.3511 204.187800768 (1Z,5Z)-1,5-dimethyl-8-(propan-2-ylidene)cyclodeca-1,5-diene (1Z,4Z)-germacrene B 15423-57-1 CC(C)=C1CC\C(C)=C/CC\C(C)=C/C1 InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9H,5,7-8,10-11H2,1-4H3/b13-6-,14-9- GXEGJTGWYVZSNR-OMQMMEOVSA-N belongs to the class of organic compounds known as germacrane sesquiterpenoids. These are sesquiterpenoids having the germacrane skeleton, with a structure characterized by a cyclodecane ring substituted with an isopropyl and two methyl groups. Germacrane sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homomonocyclic compounds Branched unsaturated hydrocarbons Cyclic olefins Unsaturated aliphatic hydrocarbons Aliphatic homomonocyclic compound Branched unsaturated hydrocarbon Cyclic olefin Germacrane sesquiterpenoid Hydrocarbon Olefin Unsaturated aliphatic hydrocarbon Unsaturated hydrocarbon Germacrane sesquiterpenoids germacrene B logp 5.87 ALOGPS logs -3.51 ALOGPS solubility 6.30e-02 g/l ALOGPS logp 4.78 ChemAxon iupac (1Z,5Z)-1,5-dimethyl-8-(propan-2-ylidene)cyclodeca-1,5-diene ChemAxon average_mass 204.3511 ChemAxon mono_mass 204.187800768 ChemAxon smiles CC(C)=C1CC\C(C)=C/CC\C(C)=C/C1 ChemAxon formula C15H24 ChemAxon inchi InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9H,5,7-8,10-11H2,1-4H3/b13-6-,14-9- ChemAxon inchikey GXEGJTGWYVZSNR-OMQMMEOVSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 71.09 ChemAxon polarizability 26.14 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12507 Specdb::CMs 160661 Specdb::MsMs 82623 Specdb::MsMs 82624 Specdb::MsMs 82625 Specdb::MsMs 144048 Specdb::MsMs 144049 Specdb::MsMs 144050 Specdb::MsMs 2281501 Specdb::MsMs 2281502 Specdb::MsMs 2281503 Specdb::MsMs 3083842 Specdb::MsMs 3083843 Specdb::MsMs 3083844 HMDB36575 #<Reference:0x000055ce3230d558> Citrus Unknown generic Common oregano Type 1 specific Origanum vulgare 39352 Grape Type 1 specific Vitis 3603 Lime Type 1 specific Citrus aurantiifolia 159033 Pepper (Spice) Type 1 specific Piper nigrum 13216 earth earthy spice spicy wood woody