1.0 2010-04-08 22:11:54 UTC 2025-11-19 00:55:54 UTC FDB015536 7-Methylchrysin 7-methylchrysin, also known as 5-hydroxy-7-methoxyflavone or techtochrysin, is a member of the class of compounds known as 7-o-methylated flavonoids. 7-o-methylated flavonoids are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. Thus, 7-methylchrysin is considered to be a flavonoid lipid molecule. 7-methylchrysin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 7-methylchrysin can be found in pine nut, prunus (cherry, plum), sour cherry, and sweet cherry, which makes 7-methylchrysin a potential biomarker for the consumption of these food products. 4H-1-Benzopyran-4-one, 5-hydroxy-7-methoxy-2-phenyl- (9CI) 5-Hydroxy-7-methoxy-2-phenyl-4H-chromen-4-one 5-Hydroxy-7-methoxy-2-phenyl-chromen-4-one 5-Hydroxy-7-methoxyflavone 7-Methoxy-5-hydroxyflavone 7-Methylchrysin Techtochrysin Tectochrysin C16H12O4 268.2641 268.073558872 5-hydroxy-7-methoxy-2-phenyl-4H-chromen-4-one tectochrysin 520-28-5 COC1=CC(O)=C2C(=O)C=C(OC2=C1)C1=CC=CC=C1 InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 IRZVHDLBAYNPCT-UHFFFAOYSA-N belongs to the class of organic compounds known as 7-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. 7-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 5-hydroxyflavonoids Alkyl aryl ethers Anisoles Benzene and substituted derivatives Chromones Flavones Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Oxacyclic compounds Pyranones and derivatives Vinylogous acids 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 5-hydroxyflavonoid 7-methoxyflavonoid-skeleton Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Ether Flavone Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Monocyclic benzene moiety Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Pyran Pyranone Vinylogous acid Flavones and Flavonols Flavones and Flavonols flavones monohydroxyflavone monomethoxyflavone logp 3.71 ALOGPS logs -3.71 ALOGPS solubility 5.22e-02 g/l ALOGPS melting_point Mp 163° logp 3.16 ChemAxon pka_strongest_acidic 7.37 ChemAxon pka_strongest_basic -4.7 ChemAxon iupac 5-hydroxy-7-methoxy-2-phenyl-4H-chromen-4-one ChemAxon average_mass 268.2641 ChemAxon mono_mass 268.073558872 ChemAxon smiles COC1=CC(O)=C2C(=O)C=C(OC2=C1)C1=CC=CC=C1 ChemAxon formula C16H12O4 ChemAxon inchi InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 ChemAxon inchikey IRZVHDLBAYNPCT-UHFFFAOYSA-N ChemAxon polar_surface_area 55.76 ChemAxon refractivity 75.42 ChemAxon polarizability 27.81 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1764 Specdb::CMs 99207 Specdb::MsMs 69291 Specdb::MsMs 69292 Specdb::MsMs 69293 Specdb::MsMs 127536 Specdb::MsMs 127537 Specdb::MsMs 127538 Specdb::MsMs 285762 Specdb::MsMs 285763 Specdb::MsMs 285764 Specdb::MsMs 285765 Specdb::MsMs 285766 Pine nut Type 1 specific Pinus 3337 Prunus (Cherry, Plum) Type 1 specific Prunus 3754 Sour cherry Type 1 specific Prunus cerasus 140311 Sweet cherry Type 1 specific Prunus avium 42229