1.0 2010-04-08 22:11:54 UTC 2025-11-19 00:55:58 UTC FDB015544 Noreugenin Noreugenin, also known as 5,7-dihydroxy-2-methyl-4h-1-benzopyran-4-one, is a member of the class of compounds known as chromones. Chromones are compounds containing a benzopyran-4-one moiety. Noreugenin is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Noreugenin can be found in carrot and wild carrot, which makes noreugenin a potential biomarker for the consumption of these food products. 5,7-Dihydroxy-2-methylchromone Noreugenin C10H8O4 192.1681 192.042258744 5,7-dihydroxy-2-methyl-4H-chromen-4-one 5,7-dihydroxy-2-methylchromen-4-one 1013-69-0 CC1=CC(=O)C2=C(O1)C=C(O)C=C2O InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3 NCUJRUDLFCGVOE-UHFFFAOYSA-N belongs to the class of organic compounds known as chromones. Chromones are compounds containing a benzopyran-4-one moiety. Chromones Organic compounds Organoheterocyclic compounds Benzopyrans 1-benzopyrans Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Organooxygen compounds Oxacyclic compounds Pyranones and derivatives Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic heteropolycyclic compound Benzenoid Chromone Heteroaromatic compound Hydrocarbon derivative Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Pyran Pyranone Vinylogous acid a polyketide chromones resorcinols logp 1.64 ALOGPS logs -1.77 ALOGPS solubility 3.27e+00 g/l ALOGPS logp 1.91 ChemAxon pka_strongest_acidic 6.65 ChemAxon pka_strongest_basic -5.2 ChemAxon iupac 5,7-dihydroxy-2-methyl-4H-chromen-4-one ChemAxon average_mass 192.1681 ChemAxon mono_mass 192.042258744 ChemAxon smiles CC1=CC(=O)C2=C(O1)C=C(O)C=C2O ChemAxon formula C10H8O4 ChemAxon inchi InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3 ChemAxon inchikey NCUJRUDLFCGVOE-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 51.07 ChemAxon polarizability 18.45 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 3291 Specdb::CMs 1088071 Specdb::MsMs 70302 Specdb::MsMs 70303 Specdb::MsMs 70304 Specdb::MsMs 128775 Specdb::MsMs 128776 Specdb::MsMs 128777 Specdb::MsMs 3605812 Specdb::MsMs 3605813 Specdb::MsMs 3605814 Specdb::MsMs 3605815 Specdb::MsMs 3605816 Specdb::MsMs 3605817 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Wild carrot Type 1 specific Daucus carota 4039