1.0 2010-04-08 22:11:57 UTC 2019-11-26 03:11:55 UTC FDB015607 Strigol Constituent of the root of Gossypium hirsutum (cotton) Strigolactones are plant hormones that have been implicated in inhibition of shoot branching. Strigolactones are carotenoid-derived and trigger germination of parasitic plant seeds (for example striga from which they gained their name) and stimulate symbiotic mycorrhizal fungi. Strigolactones contain a labile ether bond that is easily hydrolysed in the rhizosphere meaning that there is a large concentration gradient between areas near the root and those further away. Strigol is found in millet, fats and oils, and corn. C19H22O6 346.3744 346.141638436 5-{[(3E)-5-hydroxy-8,8-dimethyl-2-oxo-2H,3H,3aH,4H,5H,6H,7H,8H,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-2,5-dihydrofuran-2-one 5-{[(3E)-5-hydroxy-8,8-dimethyl-2-oxo-3aH,4H,5H,6H,7H,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-5H-furan-2-one 11017-56-4 CC1=CC(O\C=C2/C3CC4=C(C3OC2=O)C(C)(C)CCC4O)OC1=O InChI=1S/C19H22O6/c1-9-6-14(24-17(9)21)23-8-12-10-7-11-13(20)4-5-19(2,3)15(11)16(10)25-18(12)22/h6,8,10,13-14,16,20H,4-5,7H2,1-3H3/b12-8+ VOFXXOPWCBSPAA-XYOKQWHBSA-N belongs to the class of organic compounds known as strigolactones. These are terpene lactones structurally characterized by the presence of an indeno[1,2-b]furan and a 2,5-dihydrofuran-2-one linked together to form a 3-methyl-5-{8-methyl-2-oxo-indeno[1,2-b]furan-3-ylidene]methoxy}-2,5-dihydrofuran-2-one skeleton. Strigolactones Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Acetals Butenolides Carbonyl compounds Cyclic alcohols and derivatives Dicarboxylic acids and derivatives Enoate esters Gamma butyrolactones Hydrocarbon derivatives Organic oxides Oxacyclic compounds Secondary alcohols Tetrahydrofurans Vinylogous esters 2-furanone Acetal Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Dicarboxylic acid or derivatives Dihydrofuran Enoate ester Gamma butyrolactone Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Secondary alcohol Strigolactone Tetrahydrofuran Vinylogous ester logp 2.70 ALOGPS logs -3.37 ALOGPS solubility 1.49e-01 g/l ALOGPS melting_point Mp 200-202 dec.(191-193°) logp 2.35 ChemAxon pka_strongest_acidic 14.49 ChemAxon pka_strongest_basic -3 ChemAxon iupac 5-{[(3E)-5-hydroxy-8,8-dimethyl-2-oxo-2H,3H,3aH,4H,5H,6H,7H,8H,8bH-indeno[1,2-b]furan-3-ylidene]methoxy}-3-methyl-2,5-dihydrofuran-2-one ChemAxon average_mass 346.3744 ChemAxon mono_mass 346.141638436 ChemAxon smiles CC1=CC(O\C=C2/C3CC4=C(C3OC2=O)C(C)(C)CCC4O)OC1=O ChemAxon formula C19H22O6 ChemAxon inchi InChI=1S/C19H22O6/c1-9-6-14(24-17(9)21)23-8-12-10-7-11-13(20)4-5-19(2,3)15(11)16(10)25-18(12)22/h6,8,10,13-14,16,20H,4-5,7H2,1-3H3/b12-8+ ChemAxon inchikey VOFXXOPWCBSPAA-XYOKQWHBSA-N ChemAxon polar_surface_area 82.06 ChemAxon refractivity 88.87 ChemAxon polarizability 35.75 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26440 Specdb::CMs 44970 Specdb::CMs 131583 Specdb::CMs 139317 Specdb::MsMs 45138 Specdb::MsMs 45139 Specdb::MsMs 45140 Specdb::MsMs 138582 Specdb::MsMs 138583 Specdb::MsMs 138584 Specdb::MsMs 3040642 Specdb::MsMs 3040643 Specdb::MsMs 3040644 Specdb::MsMs 3103559 Specdb::MsMs 3103560 Specdb::MsMs 3103561 HMDB36677 #<Reference:0x00007f093c19fe78> Corn Type 1 specific Zea mays 4577 Fats and oils Unknown generic Millet Type 1 specific Panicum miliaceum 4540