1.0 2010-04-08 22:11:57 UTC 2025-11-19 00:56:50 UTC FDB015625 Tulipinolide Tulipinolide belongs to germacranolides and derivatives class of compounds. Those are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Tulipinolide is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Tulipinolide can be found in sweet bay, which makes tulipinolide a potential biomarker for the consumption of this food product. Tulipinolide C17H22O4 290.3542 290.151809192 6,10-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl acetate 6,10-dimethyl-3-methylidene-2-oxo-3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl acetate 24164-12-3 CC(=O)OC1C\C(C)=C\CC\C(C)=C\C2OC(=O)C(=C)C12 InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+ UPNVKIZABMRHNR-BBYAVRKXSA-N belongs to the class of organic compounds known as germacranolides and derivatives. These are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Germacranolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Carbonyl compounds Dicarboxylic acids and derivatives Enoate esters Gamma butyrolactones Germacrane sesquiterpenoids Hydrocarbon derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Enoate ester Gamma butyrolactone Germacrane sesquiterpenoid Germacranolide Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Sesquiterpenoid Tetrahydrofuran logp 3.29 ALOGPS logs -3.54 ALOGPS solubility 8.47e-02 g/l ALOGPS melting_point Mp 181° dec. logp 2.91 ChemAxon pka_strongest_acidic 6.2 ChemAxon pka_strongest_basic -6.6 ChemAxon iupac 6,10-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,8H,9H,11aH-cyclodeca[b]furan-4-yl acetate ChemAxon average_mass 290.3542 ChemAxon mono_mass 290.151809192 ChemAxon smiles CC(=O)OC1C\C(C)=C\CC\C(C)=C\C2OC(=O)C(=C)C12 ChemAxon formula C17H22O4 ChemAxon inchi InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+ ChemAxon inchikey UPNVKIZABMRHNR-BBYAVRKXSA-N ChemAxon polar_surface_area 52.6 ChemAxon refractivity 80.67 ChemAxon polarizability 30.85 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 95511 Specdb::MsMs 95512 Specdb::MsMs 95513 Specdb::MsMs 159786 Specdb::MsMs 159787 Specdb::MsMs 159788 Specdb::MsMs 3605833 Specdb::MsMs 3605834 Specdb::MsMs 3605835 Specdb::MsMs 3605836 Specdb::MsMs 3605837 Specdb::MsMs 3605838 9776 Sweet bay Type 1 specific Laurus nobilis 85223 Antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms. Cytotoxic 859 A role played by the molecular entity or part thereof which causes the development of a pathological process.