1.0 2010-04-08 22:12:02 UTC 2019-11-26 03:12:10 UTC FDB015764 Norecasantalic acid Flavouring ingredient. Constituent from oil of the famine food Santalum album (sandalwood). Norecasantalic acid is found in cereals and cereal products. 10,11,12,13-Tetranor-a-santalan-9-oic acid eka-Nortricyclosantalic acid Norecasantalic acid Nortricycloekasantalic acid C11H16O2 180.2435 180.115029756 2-{2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}acetic acid {2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}acetic acid 59300-52-6 CC12C3CC(CC13)C2(C)CC(O)=O InChI=1S/C11H16O2/c1-10(5-9(12)13)6-3-7-8(4-6)11(7,10)2/h6-8H,3-5H2,1-2H3,(H,12,13) LDSSHHGVKDZTIX-UHFFFAOYSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homopolycyclic compound Bornane monoterpenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 2.03 ALOGPS logs -2.45 ALOGPS solubility 6.45e-01 g/l ALOGPS melting_point Mp 93° logp 1.57 ChemAxon pka_strongest_acidic 4.71 ChemAxon iupac 2-{2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl}acetic acid ChemAxon average_mass 180.2435 ChemAxon mono_mass 180.115029756 ChemAxon smiles CC12C3CC(CC13)C2(C)CC(O)=O ChemAxon formula C11H16O2 ChemAxon inchi InChI=1S/C11H16O2/c1-10(5-9(12)13)6-3-7-8(4-6)11(7,10)2/h6-8H,3-5H2,1-2H3,(H,12,13) ChemAxon inchikey LDSSHHGVKDZTIX-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 48.16 ChemAxon polarizability 19.71 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 9448 Specdb::CMs 45052 Specdb::CMs 157737 Specdb::MsMs 55809 Specdb::MsMs 55810 Specdb::MsMs 55811 Specdb::MsMs 111042 Specdb::MsMs 111043 Specdb::MsMs 111044 Specdb::MsMs 2282863 Specdb::MsMs 2282864 Specdb::MsMs 2282865 Specdb::MsMs 3086833 Specdb::MsMs 3086834 Specdb::MsMs 3086835 HMDB36817 #<Reference:0x000055ce2ec62f58> Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic