1.0 2010-04-08 22:12:14 UTC 2025-11-19 01:43:52 UTC FDB016108 (±)-2-Hydroxy-4-(methylthio)butanoic acid Animal and poultry feed additive (+-)-2-Hydroxy-4-(methylthio)butyric acid 2-Hydroxy-4-(methylthio) butanoic acid 2-Hydroxy-4-(methylthio)-butanoic acid 2-Hydroxy-4-(methylthio)-butyric acid 2-Hydroxy-4-(methylthio)butanoic acid 2-Hydroxy-4-(methylthio)butyric acid 4857-44-7 (calcium[2:1] salt) Alimet Alpha-hydroxy-gamma-(methylmercapto)butyric acid Alpha-hydroxy-gamma-(methylthio)butyric acid Alpha-hydroxy-gamma-methylmercaptobutyric acid Butanoic acid, 2-hydroxy-4-(methylthio)- Butyric acid, 2-hydroxy-4-(methylthio)- Desmeninol Desmeninol [inn] Gamma-(methylthio)-alpha-hydroxybutyric acid Methionine hydroxy analog MHA Mha acid Mha-fa C5H10O3S 150.196 150.035064876 2-hydroxy-4-(methylsulfanyl)butanoic acid methionine hydroxy analog 120-91-2 CSCCC(O)C(O)=O InChI=1S/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) ONFOSYPQQXJWGS-UHFFFAOYSA-N belongs to the class of organic compounds known as thia fatty acids. These are fatty acid derivatives obtained by insertion of a sulfur atom at specific positions in the chain. Thia fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Dialkylthioethers Hydrocarbon derivatives Hydroxy fatty acids Monocarboxylic acids and derivatives Monosaccharides Organic oxides Secondary alcohols Sulfenyl compounds Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Dialkylthioether Hydrocarbon derivative Hydroxy acid Hydroxy fatty acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Organosulfur compound Secondary alcohol Sulfenyl compound Thia fatty acid Thioether logp -0.40 ALOGPS logs -0.56 ALOGPS solubility 4.09e+01 g/l ALOGPS melting_point Mp 250° (Zn salt) logp 0.18 ChemAxon pka_strongest_acidic 4.03 ChemAxon pka_strongest_basic -3.8 ChemAxon iupac 2-hydroxy-4-(methylsulfanyl)butanoic acid ChemAxon average_mass 150.196 ChemAxon mono_mass 150.035064876 ChemAxon smiles CSCCC(O)C(O)=O ChemAxon formula C5H10O3S ChemAxon inchi InChI=1S/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) ChemAxon inchikey ONFOSYPQQXJWGS-UHFFFAOYSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 35.93 ChemAxon polarizability 15.09 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19568 Specdb::CMs 45245 Specdb::CMs 171972 Specdb::MsMs 94653 Specdb::MsMs 94654 Specdb::MsMs 94655 Specdb::MsMs 158724 Specdb::MsMs 158725 Specdb::MsMs 158726 Specdb::MsMs 2236238 Specdb::MsMs 2238412 Specdb::MsMs 2239192 Specdb::MsMs 2338782 Specdb::MsMs 2338783 Specdb::MsMs 2338784 Specdb::MsMs 2623976 Specdb::MsMs 2623977 Specdb::MsMs 2623978 Specdb::NmrOneD 138970 Specdb::NmrOneD 138971 Specdb::NmrOneD 138972 Specdb::NmrOneD 138973 Specdb::NmrOneD 138974 Specdb::NmrOneD 138975 Specdb::NmrOneD 138976 Specdb::NmrOneD 138977 Specdb::NmrOneD 138978 Specdb::NmrOneD 138979 Specdb::NmrOneD 138980 Specdb::NmrOneD 138981 Specdb::NmrOneD 138982 Specdb::NmrOneD 138983 Specdb::NmrOneD 138984 Specdb::NmrOneD 138985 Specdb::NmrOneD 138986 Specdb::NmrOneD 138987 Specdb::NmrOneD 138988 Specdb::NmrOneD 138989 Specdb::MsIr 7386 Specdb::MsIr 7387 Specdb::MsIr 7388 HMDB37115 #<Reference:0x000055ce32287660>