1.0 2010-04-08 22:12:18 UTC 2025-11-19 01:45:20 UTC FDB016202 D-Gluconic acid Mn(II) salt Dietary supplement Gluconic acid (manganese[2:1] salt) C12H22MnO14 445.2327 445.039005048 manganese(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) manganese(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) 6485-39-8 [Mn++].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O InChI=1S/2C6H12O7.Mn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 OXHQNTSSPHKCPB-UHFFFAOYSA-L belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. Medium-chain hydroxy acids and derivatives Organic compounds Organic acids and derivatives Hydroxy acids and derivatives Medium-chain hydroxy acids and derivatives Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid salts Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Monocarboxylic acids and derivatives Monosaccharides Organic oxides Organic transition metal salts Organic zwitterions Polyols Primary alcohols Secondary alcohols Alcohol Aliphatic acyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Medium-chain hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic oxide Organic oxygen compound Organic salt Organic transition metal salt Organic zwitterion Organooxygen compound Polyol Primary alcohol Secondary alcohol logp -1.96 ALOGPS logs -1.09 ALOGPS solubility 3.63e+01 g/l ALOGPS melting_point 113-118 oC logp -3.4 ChemAxon pka_strongest_acidic 3.39 ChemAxon pka_strongest_basic -3 ChemAxon iupac manganese(2+) ion bis(2,3,4,5,6-pentahydroxyhexanoate) ChemAxon average_mass 445.2327 ChemAxon mono_mass 445.039005048 ChemAxon smiles [Mn++].OCC(O)C(O)C(O)C(O)C([O-])=O.OCC(O)C(O)C(O)C(O)C([O-])=O ChemAxon formula C12H22MnO14 ChemAxon inchi InChI=1S/2C6H12O7.Mn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 ChemAxon inchikey OXHQNTSSPHKCPB-UHFFFAOYSA-L ChemAxon polar_surface_area 141.28 ChemAxon refractivity 49.11 ChemAxon polarizability 16.75 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 7 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon HMDB37198