1.0 2010-04-08 22:12:21 UTC 2015-10-09 22:32:40 UTC FDB016288 Fenpropimorph Agricultural fungicide used against powdery mildews on sugar beet, beans and leeks 4-[3-(4-tert-Butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine 4-[3-[4-(1,1-Dimethylethyl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine, 9CI Corbel Fenpropemorph Fenpropimorph Fenpropimorphe Funbas Mildofix Mistral Mistral t Power task C20H33NO 303.4821 303.256214683 4-{2-[(4-tert-butylphenyl)methyl]propyl}-2,6-dimethylmorpholine corbel 67306-03-0 CC(CN1CC(C)OC(C)C1)CC1=CC=C(C=C1)C(C)(C)C InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3 RYAUSSKQMZRMAI-UHFFFAOYSA-N belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. Phenylpropanes Organic compounds Benzenoids Benzene and substituted derivatives Phenylpropanes Aromatic heteromonocyclic compounds Aralkylamines Azacyclic compounds Dialkyl ethers Hydrocarbon derivatives Morpholines Organopnictogen compounds Oxacyclic compounds Trialkylamines Amine Aralkylamine Aromatic heteromonocyclic compound Azacycle Dialkyl ether Ether Hydrocarbon derivative Morpholine Organic nitrogen compound Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Oxazinane Phenylpropane Tertiary aliphatic amine Tertiary amine morpholines logp 5.70 ALOGPS logs -5.19 ALOGPS solubility 1.97e-03 g/l ALOGPS melting_point < 25 oC logp 5.17 ChemAxon pka_strongest_basic 8.49 ChemAxon iupac 4-{2-[(4-tert-butylphenyl)methyl]propyl}-2,6-dimethylmorpholine ChemAxon average_mass 303.4821 ChemAxon mono_mass 303.256214683 ChemAxon smiles CC(CN1CC(C)OC(C)C1)CC1=CC=C(C=C1)C(C)(C)C ChemAxon formula C20H33NO ChemAxon inchi InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3 ChemAxon inchikey RYAUSSKQMZRMAI-UHFFFAOYSA-N ChemAxon polar_surface_area 12.47 ChemAxon refractivity 95.01 ChemAxon polarizability 38.34 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1754 Specdb::CMs 23886 Specdb::MsMs 91644 Specdb::MsMs 91645 Specdb::MsMs 91646 Specdb::MsMs 155082 Specdb::MsMs 155083 Specdb::MsMs 155084 Specdb::MsMs 448858 Specdb::MsMs 448859 Specdb::MsMs 448860 Specdb::MsMs 448861 HMDB37270 50148 #<Reference:0x000055ce324f66a8> #<Reference:0x000055ce324f64c8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823