1.0 2010-04-08 22:12:32 UTC 2019-11-26 03:13:30 UTC FDB016609 Blennin B Constituent of Lactarius blennius (slimy milk cap). Blennin B is found in mushrooms. Blennin B C15H20O4 264.3169 264.136159128 3,4-dihydroxy-6,6,8-trimethyl-1H,3H,4H,4aH,5H,6H,7H,9H-azuleno[5,6-c]furan-1-one 3,4-dihydroxy-6,6,8-trimethyl-3H,4H,4aH,5H,7H,9H-azuleno[5,6-c]furan-1-one 62824-37-7 CC1=C2CC(C)(C)CC2C(O)C2=C(C1)C(=O)OC2O InChI=1S/C15H20O4/c1-7-4-8-11(14(18)19-13(8)17)12(16)10-6-15(2,3)5-9(7)10/h10,12,14,16,18H,4-6H2,1-3H3 SEYJJRRZTHFAPX-UHFFFAOYSA-N belongs to the class of organic compounds known as terpene lactones. These are prenol lipids containing a lactone ring. Terpene lactones Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Butenolides Carbonyl compounds Enoate esters Hemiacetals Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Secondary alcohols Sesquiterpenoids 2-furanone Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dihydrofuran Enoate ester Hemiacetal Hydrocarbon derivative Lactarane sesquiterpenoid Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Secondary alcohol Sesquiterpenoid Terpene lactone logp 0.70 ALOGPS logs -2.24 ALOGPS solubility 1.51e+00 g/l ALOGPS logp 1.51 ChemAxon pka_strongest_acidic 11.54 ChemAxon pka_strongest_basic -3.2 ChemAxon iupac 3,4-dihydroxy-6,6,8-trimethyl-1H,3H,4H,4aH,5H,6H,7H,9H-azuleno[5,6-c]furan-1-one ChemAxon average_mass 264.3169 ChemAxon mono_mass 264.136159128 ChemAxon smiles CC1=C2CC(C)(C)CC2C(O)C2=C(C1)C(=O)OC2O ChemAxon formula C15H20O4 ChemAxon inchi InChI=1S/C15H20O4/c1-7-4-8-11(14(18)19-13(8)17)12(16)10-6-15(2,3)5-9(7)10/h10,12,14,16,18H,4-6H2,1-3H3 ChemAxon inchikey SEYJJRRZTHFAPX-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 70.41 ChemAxon polarizability 28.43 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17930 Specdb::CMs 45440 Specdb::CMs 171447 Specdb::MsMs 76731 Specdb::MsMs 76732 Specdb::MsMs 76733 Specdb::MsMs 136647 Specdb::MsMs 136648 Specdb::MsMs 136649 Specdb::MsMs 2802097 Specdb::MsMs 2802098 Specdb::MsMs 2802099 Specdb::MsMs 2880194 Specdb::MsMs 2880195 Specdb::MsMs 2880196 HMDB37528 #<Reference:0x000055ce32d24a28> Common mushroom Type 1 specific Agaricus bisporus 5341 Mushrooms Unknown generic Oyster mushroom Type 1 specific Pleurotus ostreatus 5322