1.0 2010-04-08 22:12:35 UTC 2025-11-19 01:49:13 UTC FDB016703 6-Hydroxyluteolin 6,7,3',4'-tetramethyl ether 6-hydroxyluteolin 6,7,3',4'-tetramethyl ether, also known as 5-demethylsinensetin or 5-hydroxy-3',4',6,7-tetramethoxyflavone, is a member of the class of compounds known as 7-o-methylated flavonoids. 7-o-methylated flavonoids are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. Thus, 6-hydroxyluteolin 6,7,3',4'-tetramethyl ether is considered to be a flavonoid lipid molecule. 6-hydroxyluteolin 6,7,3',4'-tetramethyl ether is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 6-hydroxyluteolin 6,7,3',4'-tetramethyl ether can be found in mandarin orange (clementine, tangerine) and spearmint, which makes 6-hydroxyluteolin 6,7,3',4'-tetramethyl ether a potential biomarker for the consumption of these food products. 2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one 5-Hydroxy-3',4',6,7-tetramethoxyflavone 5-Hydroxy-6,7,3',4'-tetramethoxyflavone 6-Hydroxyluteolin 6,7,3',4'-tetramethyl ether HTMF C19H18O7 358.342 358.10525293 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-chromen-4-one 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7-dimethoxychromen-4-one 21763-80-4 COC1=C(OC)C=C(C=C1)C1=CC(=O)C2=C(O)C(OC)=C(OC)C=C2O1 InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 QEWSAPKRFOFQIU-UHFFFAOYSA-N belongs to the class of organic compounds known as 7-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C7 atom of the flavonoid backbone. 7-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 1-hydroxy-4-unsubstituted benzenoids 3'-O-methylated flavonoids 4'-O-methylated flavonoids 5-hydroxyflavonoids 6-O-methylated flavonoids Alkyl aryl ethers Anisoles Chromones Dimethoxybenzenes Flavones Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Oxacyclic compounds Phenoxy compounds Pyranones and derivatives Vinylogous acids 1-benzopyran 1-hydroxy-4-unsubstituted benzenoid 3p-methoxyflavonoid-skeleton 4p-methoxyflavonoid-skeleton 5-hydroxyflavonoid 6-methoxyflavonoid-skeleton 7-methoxyflavonoid-skeleton Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Dimethoxybenzene Ether Flavone Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Methoxybenzene Monocyclic benzene moiety O-dimethoxybenzene Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol ether Phenoxy compound Pyran Pyranone Vinylogous acid Flavones and Flavonols logp 3.03 ALOGPS logs -4.18 ALOGPS solubility 2.38e-02 g/l ALOGPS melting_point Mp 197-199° (189-190°) logp 2.68 ChemAxon pka_strongest_acidic 7.94 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-chromen-4-one ChemAxon average_mass 358.342 ChemAxon mono_mass 358.10525293 ChemAxon smiles COC1=C(OC)C=C(C=C1)C1=CC(=O)C2=C(O)C(OC)=C(OC)C=C2O1 ChemAxon formula C19H18O7 ChemAxon inchi InChI=1S/C19H18O7/c1-22-12-6-5-10(7-14(12)23-2)13-8-11(20)17-15(26-13)9-16(24-3)19(25-4)18(17)21/h5-9,21H,1-4H3 ChemAxon inchikey QEWSAPKRFOFQIU-UHFFFAOYSA-N ChemAxon polar_surface_area 83.45 ChemAxon refractivity 94.8 ChemAxon polarizability 36.95 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 56370 Specdb::MsMs 56371 Specdb::MsMs 56372 Specdb::MsMs 111768 Specdb::MsMs 111769 Specdb::MsMs 111770 Specdb::CMs 93659 Amaranth Type 1 specific Amaranthus 3564 Annual wild rice Type 1 specific Zizania aquatica 75727 Barley Type 1 specific Hordeum vulgare 4513 Breakfast cereal Type 2 specific Bulgur Type 2 specific Cereals and cereal products Unknown generic Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Flour Type 2 specific Hard wheat Type 1 specific Triticum durum 4567 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 Millet Type 1 specific Panicum miliaceum 4540 Oat Type 1 specific Avena sativa 4498 Oriental wheat Type 1 specific Triticum turanicum 376534 Quinoa Type 1 specific Chenopodium quinoa 63459 Red rice Type 1 specific Oryza rufipogon 4529 Rice Type 1 specific Oryza sativa 4530 Rye Type 1 specific Secale cereale 4550 Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 Triticale Type 1 specific X Triticosecale rimpaui Wheat Type 1 specific Triticum 4564 Wild rice Type 1 specific Zizania 15949