1.0 2010-04-08 22:12:38 UTC 2019-11-26 03:13:44 UTC FDB016760 o-Ferulic acid Present in wheat shoots. o-Ferulic acid is found in common wheat. 2-Hydroxy-3-methoxycinnamic acid 3-(2-Hydroxy-3-methoxyphenyl)-2-propenoic acid, 9CI o-Ferulic acid Orthoferulic acid C10H10O4 194.184 194.057908808 (2E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoic acid (2E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoic acid 3626-94-6 COC1=CC=CC(\C=C\C(O)=O)=C1O InChI=1S/C10H10O4/c1-14-8-4-2-3-7(10(8)13)5-6-9(11)12/h2-6,13H,1H3,(H,11,12)/b6-5+ VZFPHVWLPRCAGD-AATRIKPKSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-4-unsubstituted benzenoids Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids and derivatives Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes 1-hydroxy-4-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid or derivatives Ether Hydrocarbon derivative Hydroxycinnamic acid Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Styrene logp 1.74 ALOGPS logs -2.25 ALOGPS solubility 1.08e+00 g/l ALOGPS melting_point Mp 183-184° logp 1.67 ChemAxon pka_strongest_acidic 3.8 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac (2E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 194.184 ChemAxon mono_mass 194.057908808 ChemAxon smiles COC1=CC=CC(\C=C\C(O)=O)=C1O ChemAxon formula C10H10O4 ChemAxon inchi InChI=1S/C10H10O4/c1-14-8-4-2-3-7(10(8)13)5-6-9(11)12/h2-6,13H,1H3,(H,11,12)/b6-5+ ChemAxon inchikey VZFPHVWLPRCAGD-AATRIKPKSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 51.5 ChemAxon polarizability 19.21 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16301 Specdb::CMs 45500 Specdb::CMs 167269 Specdb::MsIr 7588 Specdb::MsIr 7589 Specdb::MsIr 7590 Specdb::MsMs 103380 Specdb::MsMs 103381 Specdb::MsMs 103382 Specdb::MsMs 169410 Specdb::MsMs 169411 Specdb::MsMs 169412 Specdb::MsMs 3052922 Specdb::MsMs 3052923 Specdb::MsMs 3052924 Specdb::MsMs 3114044 Specdb::MsMs 3114045 Specdb::MsMs 3114046 HMDB37644 #<Reference:0x000055ce30108a48> Common wheat Type 1 specific Triticum aestivum 4565