1.0 2010-04-08 22:12:39 UTC 2015-07-20 23:32:37 UTC FDB016794 o-Tolyl salicylate Flavouring ingredient 2-Methylphenyl 2-hydroxybenzoate 2-Methylphenyl salicylate Benzoic acid, 2-hydroxy-, 2-methylphenyl ester Cresyl salicylate, o- FEMA 3734 O-Cresyl salicylate o-Tolyl salicylate Salicylic acid, o-tolyl ester Tolyl salicylate, o- C14H12O3 228.2433 228.07864425 2-methylphenyl 2-hydroxybenzoate 2-methylphenyl 2-hydroxybenzoate 617-01-6 CC1=CC=CC=C1OC(=O)C1=CC=CC=C1O InChI=1S/C14H12O3/c1-10-6-2-5-9-13(10)17-14(16)11-7-3-4-8-12(11)15/h2-9,15H,1H3 KITKATPLNVHGFC-UHFFFAOYSA-N belongs to the class of organic compounds known as depsides and depsidones. These are polycyclic compounds that is either a polyphenolic compound composed of two or more monocyclic aromatic units linked by an ester bond (depside), or a compound containing the depsidone structure (depsidone). Depsides and depsidones Organic compounds Phenylpropanoids and polyketides Depsides and depsidones Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Benzoyl derivatives Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Phenol esters Phenoxy compounds Salicylic acid and derivatives Toluenes Vinylogous acids o-Hydroxybenzoic acid esters 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Benzoate ester Benzoic acid or derivatives Benzoyl Carboxylic acid derivative Carboxylic acid ester Depside backbone Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety O-hydroxybenzoic acid ester Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ester Phenoxy compound Salicylic acid or derivatives Toluene Vinylogous acid logp 3.91 ALOGPS logs -3.31 ALOGPS solubility 1.11e-01 g/l ALOGPS logp 4.49 ChemAxon pka_strongest_acidic 9.67 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac 2-methylphenyl 2-hydroxybenzoate ChemAxon average_mass 228.2433 ChemAxon mono_mass 228.07864425 ChemAxon smiles CC1=CC=CC=C1OC(=O)C1=CC=CC=C1O ChemAxon formula C14H12O3 ChemAxon inchi InChI=1S/C14H12O3/c1-10-6-2-5-9-13(10)17-14(16)11-7-3-4-8-12(11)15/h2-9,15H,1H3 ChemAxon inchikey KITKATPLNVHGFC-UHFFFAOYSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 64.88 ChemAxon polarizability 23.89 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 17264 Specdb::CMs 45511 Specdb::CMs 153603 Specdb::MsMs 74250 Specdb::MsMs 74251 Specdb::MsMs 74252 Specdb::MsMs 133584 Specdb::MsMs 133585 Specdb::MsMs 133586 Specdb::MsMs 2782999 Specdb::MsMs 2783000 Specdb::MsMs 2783001 Specdb::MsMs 2926711 Specdb::MsMs 2926712 Specdb::MsMs 2926713 HMDB37667 #<Reference:0x000055ce333912a8> eucalyptus herbal