1.0 2010-04-08 22:12:40 UTC 2025-11-19 01:50:14 UTC FDB016834 Cyclohexyl cinnamate Flavouring ingredient 2-Butenoic acid,3-phenyl, cyclohexyl ester 2-Propenoic acid, 3-phenyl-, cyclohexyl ester Cinnamic acid, cyclohexyl ester Cyclohexyl (2E)-3-phenyl-2-propenoate Cyclohexyl cinnamate FEMA 2352 C15H18O2 230.3022 230.13067982 cyclohexyl (2Z)-3-phenylprop-2-enoate cyclohexyl (2Z)-3-phenylprop-2-enoate 7779-17-1 O=C(OC1CCCCC1)\C=C/C1=CC=CC=C1 InChI=1S/C15H18O2/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2/b12-11- GCFAUZGWPDYAJN-QXMHVHEDSA-N belongs to the class of organic compounds known as cinnamic acid esters. These are compound containing an ester derivative of cinnamic acid. Cinnamic acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Cinnamic acid esters Aromatic homomonocyclic compounds Carbonyl compounds Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Styrene logp 4.31 ALOGPS logs -4.91 ALOGPS solubility 2.80e-03 g/l ALOGPS melting_point Mp 28° logp 4.31 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac cyclohexyl (2Z)-3-phenylprop-2-enoate ChemAxon average_mass 230.3022 ChemAxon mono_mass 230.13067982 ChemAxon smiles O=C(OC1CCCCC1)\C=C/C1=CC=CC=C1 ChemAxon formula C15H18O2 ChemAxon inchi InChI=1S/C15H18O2/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2/b12-11- ChemAxon inchikey GCFAUZGWPDYAJN-QXMHVHEDSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 68.84 ChemAxon polarizability 26.35 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16444 Specdb::CMs 171880 Specdb::MsMs 302350 Specdb::MsMs 302351 Specdb::MsMs 302352 Specdb::MsMs 345058 Specdb::MsMs 345059 Specdb::MsMs 345060 Specdb::MsMs 2321449 Specdb::MsMs 2321450 Specdb::MsMs 2321451 Specdb::MsMs 2614608 Specdb::MsMs 2614609 Specdb::MsMs 2614610 HMDB37706 almond cherry fruity peach