1.0 2010-04-08 22:12:41 UTC 2025-11-19 01:50:17 UTC FDB016839 4-Methylphenyl dodecanoate Flavouring ingredient with a mild, floral, sweet odour and taste 4-Methylphenyl dodecanoate Cresyl dodecanoate, p- Cresyl laurate, p- Dodecanoic acid, 4-methylphenyl ester FEMA 3076 Lauric acid, p-tolyl ester Methylphenyl dodecanoate, p- p-Tolyl laurate Tolyl dodecanoate, p- Tolyl laurate, p- C19H30O2 290.4403 290.224580204 4-methylphenyl dodecanoate 4-methylphenyl dodecanoate 10024-57-4 CCCCCCCCCCCC(=O)OC1=CC=C(C)C=C1 InChI=1S/C19H30O2/c1-3-4-5-6-7-8-9-10-11-12-19(20)21-18-15-13-17(2)14-16-18/h13-16H,3-12H2,1-2H3 GRSHNQARIXQRDQ-UHFFFAOYSA-N belongs to the class of organic compounds known as phenol esters. These are aromatic compounds containing a benzene ring substituted by a hydroxyl group and an ester group. Phenol esters Organic compounds Benzenoids Phenol esters Aromatic homomonocyclic compounds Carbonyl compounds Carboxylic acid esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Toluenes Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ester Phenoxy compound Toluene logp 7.02 ALOGPS logs -6.57 ALOGPS solubility 7.82e-05 g/l ALOGPS logp 6.8 ChemAxon pka_strongest_basic -7.2 ChemAxon iupac 4-methylphenyl dodecanoate ChemAxon average_mass 290.4403 ChemAxon mono_mass 290.224580204 ChemAxon smiles CCCCCCCCCCCC(=O)OC1=CC=C(C)C=C1 ChemAxon formula C19H30O2 ChemAxon inchi InChI=1S/C19H30O2/c1-3-4-5-6-7-8-9-10-11-12-19(20)21-18-15-13-17(2)14-16-18/h13-16H,3-12H2,1-2H3 ChemAxon inchikey GRSHNQARIXQRDQ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 88.27 ChemAxon polarizability 36.93 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26275 Specdb::CMs 152905 Specdb::MsMs 96654 Specdb::MsMs 96655 Specdb::MsMs 96656 Specdb::MsMs 161202 Specdb::MsMs 161203 Specdb::MsMs 161204 Specdb::MsMs 2793032 Specdb::MsMs 2793033 Specdb::MsMs 2793034 Specdb::MsMs 2916257 Specdb::MsMs 2916258 Specdb::MsMs 2916259 HMDB37711 floral nutty sweet vanilla