1.0 2010-04-08 22:12:45 UTC 2025-11-19 01:51:05 UTC FDB016949 Calcium bromate Dough conditioner Calcium bromate, Ca(BrO3)2, is a bromate of calcium. Bromic acid, calcium salt Br2CaO6 295.882 293.768754181 calcium dibromate calcium dibromate 10102-75-7 [Ca++].[O-][Br](=O)=O.[O-][Br](=O)=O InChI=1S/2BrHO3.Ca/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 GROPHIUSZODNGU-UHFFFAOYSA-L belongs to the class of inorganic compounds known as alkaline earth metal bromates. These are inorganic compounds in which the largest oxoanion is bromate, and in which the heaviest atom not in an oxoanion is a lanthanide. Alkaline earth metal bromates Inorganic compounds Mixed metal/non-metal compounds Alkaline earth metal oxoanionic compounds Alkaline earth metal bromates Inorganic calcium salts Inorganic oxides Alkaline earth metal bromate Inorganic calcium salt Inorganic oxide Inorganic salt logp 0.19 ChemAxon pka_strongest_acidic -30 ChemAxon iupac calcium dibromate ChemAxon average_mass 295.882 ChemAxon mono_mass 293.768754181 ChemAxon smiles [Ca++].[O-][Br](=O)=O.[O-][Br](=O)=O ChemAxon formula Br2CaO6 ChemAxon inchi InChI=1S/2BrHO3.Ca/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 ChemAxon inchikey GROPHIUSZODNGU-UHFFFAOYSA-L ChemAxon polar_surface_area 57.2 ChemAxon refractivity 13.06 ChemAxon polarizability 5.75 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon