1.0 2010-04-08 22:12:45 UTC 2025-11-19 01:51:09 UTC FDB016957 Iron(III) sodium diphosphate (1:1:1) Dietary supplement Diphosphoric acid, iron(3+) sodium salt Diphosphoric acid, iron(3+) sodium salt (1:1:1) Ferric sodium pyrophosphate Iron sodium diphosphate Iron sodium pyrophosphate Iron sodium pyrophosphate (NaFeP2O7) Iron(3+) sodium pyrophosphate Iron(III) sodium pyrophosphate Iron(III) sodium pyrophosphate, 8CI Pyrophosphoric acid, iron(3+) sodium salt (1:1:1) Sodium ferric pyrophosphate FeNaO7P2 252.778 252.836637186 iron(3+) ion sodium (phosphonatooxy)phosphonate iron(3+) ion sodium diphosphate 10045-87-1 [Na+].[Fe+3].[O-]P([O-])(=O)OP([O-])([O-])=O InChI=1S/Fe.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4 XWQGIDJIEPIQBD-UHFFFAOYSA-J belongs to the class of inorganic compounds known as transition metal pyrophosphates. These are inorganic compounds in which the largest oxoanion is pyrophosphate, and in which the heaviest atom not in an oxoanion is a transition metal. Transition metal pyrophosphates Inorganic compounds Mixed metal/non-metal compounds Transition metal oxoanionic compounds Transition metal pyrophosphates Inorganic oxides Inorganic sodium salts Inorganic oxide Inorganic salt Inorganic sodium salt Transition metal pyrophosphate logp -1.4 ChemAxon pka_strongest_acidic 1.7 ChemAxon iupac iron(3+) ion sodium (phosphonatooxy)phosphonate ChemAxon average_mass 252.778 ChemAxon mono_mass 252.836637186 ChemAxon smiles [Na+].[Fe+3].[O-]P([O-])(=O)OP([O-])([O-])=O ChemAxon formula FeNaO7P2 ChemAxon inchi InChI=1S/Fe.Na.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q+3;+1;/p-4 ChemAxon inchikey XWQGIDJIEPIQBD-UHFFFAOYSA-J ChemAxon polar_surface_area 135.61 ChemAxon refractivity 21.04 ChemAxon polarizability 9.03 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 0 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1224550 Specdb::MsMs 1224551 Specdb::MsMs 1224552