1.0 2010-04-08 22:12:45 UTC 2015-07-20 23:34:22 UTC FDB016959 2-Propenyl cyclohexanepentanoate Flavouring ingredient 2-Propen-1-yl cyclohexanepentanoate 2-Propen-1-yl cyclohexanevalerate 2-Propenyl cyclohexanepentanoate Allyl 5-cyclohexylpentanoate Allyl cyclohexanepentanoate Allyl cyclohexanevalerate Allyl cyclohexylvalerate Allyl hexahydrophenylvalerate Cyclohexanepentanoic Acid, 2-propenyl Ester Cyclohexanevaleric acid, allyl ester FEMA 2027 C14H24O2 224.3392 224.177630012 prop-2-en-1-yl 5-cyclohexylpentanoate prop-2-en-1-yl 5-cyclohexylpentanoate 7493-68-7 C=CCOC(=O)CCCCC1CCCCC1 InChI=1S/C14H24O2/c1-2-12-16-14(15)11-7-6-10-13-8-4-3-5-9-13/h2,13H,1,3-12H2 NDXGAVFJHHVIQN-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. Fatty acid esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic homomonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 5.04 ALOGPS logs -5.26 ALOGPS solubility 1.23e-03 g/l ALOGPS logp 4.29 ChemAxon pka_strongest_basic -7 ChemAxon iupac prop-2-en-1-yl 5-cyclohexylpentanoate ChemAxon average_mass 224.3392 ChemAxon mono_mass 224.177630012 ChemAxon smiles C=CCOC(=O)CCCCC1CCCCC1 ChemAxon formula C14H24O2 ChemAxon inchi InChI=1S/C14H24O2/c1-2-12-16-14(15)11-7-6-10-13-8-4-3-5-9-13/h2,13H,1,3-12H2 ChemAxon inchikey NDXGAVFJHHVIQN-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 66.16 ChemAxon polarizability 27.55 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16295 Specdb::CMs 154898 Specdb::MsMs 90084 Specdb::MsMs 90085 Specdb::MsMs 90086 Specdb::MsMs 153159 Specdb::MsMs 153160 Specdb::MsMs 153161 Specdb::MsMs 2275779 Specdb::MsMs 2275780 Specdb::MsMs 2275781 Specdb::MsMs 3093643 Specdb::MsMs 3093644 Specdb::MsMs 3093645 HMDB37814 #<Reference:0x000055ce31e7fba8> apple apricot fruity peach pineapple