1.0 2010-04-08 22:12:48 UTC 2019-11-26 03:14:07 UTC FDB017042 5-Ethyl-4-methyl-2-pentyloxazole Constituent of French fries. 5-Ethyl-4-methyl-2-pentyloxazole is found in potato. Sporeamicin a SRM-a C11H19NO 181.2747 181.146664235 5-ethyl-4-methyl-2-pentyl-1,3-oxazole 5-ethyl-4-methyl-2-pentyl-1,3-oxazole 84028-13-7 CCCCCC1=NC(C)=C(CC)O1 InChI=1S/C11H19NO/c1-4-6-7-8-11-12-9(3)10(5-2)13-11/h4-8H2,1-3H3 CJVUTPBIHCDRQD-UHFFFAOYSA-N belongs to the class of organic compounds known as 2,4,5-trisubstituted oxazoles. 2,4,5-trisubstituted oxazoles are compounds containing an oxazole ring substituted at positions 2, 4 and 5 only. Oxazole is a five-membered aromatic heterocycle with one oxygen, one nitrogen, and three carbon atoms. Isomers include 1,2-oxazole and 1,3-oxazole. 2,4,5-trisubstituted oxazoles Organic compounds Organoheterocyclic compounds Azoles Oxazoles Aromatic heteromonocyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Oxacyclic compounds 2,4,5-trisubstituted 1,3-oxazole Aromatic heteromonocyclic compound Azacycle Heteroaromatic compound Hydrocarbon derivative Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle logp 4.25 ALOGPS logs -3.41 ALOGPS solubility 7.05e-02 g/l ALOGPS logp 2.93 ChemAxon pka_strongest_basic 1.73 ChemAxon iupac 5-ethyl-4-methyl-2-pentyl-1,3-oxazole ChemAxon average_mass 181.2747 ChemAxon mono_mass 181.146664235 ChemAxon smiles CCCCCC1=NC(C)=C(CC)O1 ChemAxon formula C11H19NO ChemAxon inchi InChI=1S/C11H19NO/c1-4-6-7-8-11-12-9(3)10(5-2)13-11/h4-8H2,1-3H3 ChemAxon inchikey CJVUTPBIHCDRQD-UHFFFAOYSA-N ChemAxon polar_surface_area 26.03 ChemAxon refractivity 53.9 ChemAxon polarizability 22.87 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7760 Specdb::MsIr 7761 Specdb::CMs 14468 Specdb::CMs 155810 Specdb::MsMs 73386 Specdb::MsMs 73387 Specdb::MsMs 73388 Specdb::MsMs 132561 Specdb::MsMs 132562 Specdb::MsMs 132563 Specdb::MsMs 2264509 Specdb::MsMs 2264510 Specdb::MsMs 2264511 Specdb::MsMs 3073740 Specdb::MsMs 3073741 Specdb::MsMs 3073742 HMDB37889 #<Reference:0x000055ce31e70270> Potato Type 1 specific Solanum tuberosum 4113