1.0 2010-04-08 22:13:00 UTC 2015-07-20 23:37:19 UTC FDB017290 1,1-Diethoxy-2,6-nonadiene Flavouring ingredient 1,1-Diethoxy-2,6-nonadiene FEMA 3378 C13H24O2 212.3285 212.177630012 (2Z,6Z)-1,1-diethoxynona-2,6-diene (2Z,6Z)-1,1-diethoxynona-2,6-diene 106950-34-9 CCOC(OCC)\C=C/CC\C=C/CC InChI=1S/C13H24O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h7-8,11-13H,4-6,9-10H2,1-3H3/b8-7-,12-11- GCIRJCKOUVCUBZ-MQEUWQHPSA-N belongs to the class of organic compounds known as acetals. Acetals are compounds having the structure R2C(OR')2 ( R' not Hydrogen) and thus diethers of geminal diols. Originally, the term was confined to derivatives of aldehydes (one R = H), but it now applies equally to derivatives of ketones (neither R = H ). Mixed acetals have different R' groups. Acetals Organic compounds Organic oxygen compounds Organooxygen compounds Ethers Aliphatic acyclic compounds Hydrocarbon derivatives Acetal Aliphatic acyclic compound Hydrocarbon derivative logp 4.58 ALOGPS logs -4.37 ALOGPS solubility 9.14e-03 g/l ALOGPS logp 4.1 ChemAxon pka_strongest_basic -4 ChemAxon iupac (2Z,6Z)-1,1-diethoxynona-2,6-diene ChemAxon average_mass 212.3285 ChemAxon mono_mass 212.177630012 ChemAxon smiles CCOC(OCC)\C=C/CC\C=C/CC ChemAxon formula C13H24O2 ChemAxon inchi InChI=1S/C13H24O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h7-8,11-13H,4-6,9-10H2,1-3H3/b8-7-,12-11- ChemAxon inchikey GCIRJCKOUVCUBZ-MQEUWQHPSA-N ChemAxon polar_surface_area 18.46 ChemAxon refractivity 67.25 ChemAxon polarizability 26.02 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 13436 Specdb::CMs 146899 Specdb::MsMs 295582 Specdb::MsMs 295583 Specdb::MsMs 295584 Specdb::MsMs 336625 Specdb::MsMs 336626 Specdb::MsMs 336627 Specdb::MsMs 3056243 Specdb::MsMs 3056244 Specdb::MsMs 3056245 Specdb::MsMs 3110726 Specdb::MsMs 3110727 Specdb::MsMs 3110728 HMDB38078 #<Reference:0x000055ce327ae878>