1.0 2010-04-08 22:13:00 UTC 2025-11-19 01:53:13 UTC FDB017294 Manganese citrate Dietary supplement 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, manganese salt 2-(carboxymethyl)-2-hydroxybutanedioate 2-(carboxymethyl)-2-hydroxysuccinate Citric acid, manganese salt Manganese 2-hydroxy-1,2,3-propanetricarboxylate Manganese citrate Manganese(II) citrate C6H8MnO7 247.0616 246.965052246 2-hydroxypropane-1,2,3-tricarboxylic acid manganese citric acid manganese 10024-66-5 [Mn].OC(=O)CC(O)(CC(O)=O)C(O)=O InChI=1S/C6H8O7.Mn/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12); OKOYFIHZDKMHAM-UHFFFAOYSA-N belongs to the class of organic compounds known as tricarboxylic acids and derivatives. These are carboxylic acids containing exactly three carboxyl groups. Tricarboxylic acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Tricarboxylic acids and derivatives Aliphatic acyclic compounds Alpha hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Organic oxides Organic transition metal salts Tertiary alcohols Alcohol Aliphatic acyclic compound Alpha-hydroxy acid Carbonyl group Carboxylic acid Hydrocarbon derivative Hydroxy acid Organic oxide Organic oxygen compound Organic salt Organic transition metal salt Organooxygen compound Tertiary alcohol Tricarboxylic acid or derivatives logp -1.3 ChemAxon pka_strongest_acidic 3.05 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac 2-hydroxypropane-1,2,3-tricarboxylic acid manganese ChemAxon average_mass 247.0616 ChemAxon mono_mass 246.965052246 ChemAxon smiles [Mn].OC(=O)CC(O)(CC(O)=O)C(O)=O ChemAxon formula C6H8MnO7 ChemAxon inchi InChI=1S/C6H8O7.Mn/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12); ChemAxon inchikey OKOYFIHZDKMHAM-UHFFFAOYSA-N ChemAxon polar_surface_area 132.13 ChemAxon refractivity 35.62 ChemAxon polarizability 15.51 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 7 ChemAxon donor_count 4 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon