1.0 2010-04-08 22:13:09 UTC 2015-07-20 23:39:26 UTC FDB017533 Ferrous ascorbate Dietary supplement Dihydrogen bis(L-ascorbato(2-)-02,03)ferrate(2-) Ferrous ascorbate Ferrous cevitamate Iron(2+) di-L-ascorbate Iron(2+) L-ascorbate Iron(II) ascorbate L-Ascorbic acid, iron(2+) salt (2:1) C6H8FeO6 231.969 231.967030121 λ²-iron(2+) ion 5-(1,2-dihydroxyethyl)-3,4-dihydroxy-2,5-dihydrofuran-2-one λ²-iron(2+) ion C-level 24808-52-4 [Fe++].OCC(O)C1OC(=O)C(O)=C1O InChI=1S/C6H8O6.Fe/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+2 AJQVDIKNFUCFFB-UHFFFAOYSA-N belongs to the class of organic compounds known as butenolides. These are dihydrofurans with a carbonyl group at the C2 carbon atom. Butenolides Organic compounds Organoheterocyclic compounds Dihydrofurans Furanones Aliphatic heteromonocyclic compounds 1,2-diols Carbonyl compounds Enediols Enoate esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic cations Organic oxides Organic transition metal salts Oxacyclic compounds Primary alcohols Secondary alcohols Vinylogous acids 1,2-diol 2-furanone Alcohol Aliphatic heteromonocyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enediol Enoate ester Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Organic cation Organic oxide Organic oxygen compound Organic salt Organic transition metal salt Organooxygen compound Oxacycle Primary alcohol Secondary alcohol Vinylogous acid logp -1.9 ChemAxon pka_strongest_acidic 4.36 ChemAxon pka_strongest_basic -3 ChemAxon iupac λ²-iron(2+) ion 5-(1,2-dihydroxyethyl)-3,4-dihydroxy-2,5-dihydrofuran-2-one ChemAxon average_mass 231.969 ChemAxon mono_mass 231.967030121 ChemAxon smiles [Fe++].OCC(O)C1OC(=O)C(O)=C1O ChemAxon formula C6H8FeO6 ChemAxon inchi InChI=1S/C6H8O6.Fe/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+2 ChemAxon inchikey AJQVDIKNFUCFFB-UHFFFAOYSA-N ChemAxon polar_surface_area 107.22 ChemAxon refractivity 37.03 ChemAxon polarizability 15.04 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 2 ChemAxon