1.0 2010-04-08 22:13:09 UTC 2025-11-19 01:54:53 UTC FDB017539 Bornyl valerate Flavouring agent &alpha;-terpinyl ester of n-pentanoic acid 1,7,7-Trimethylbicyclo(2.2.1)hept-2-yl pentanoate, endo- 1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl pentanoate 2-Bornyl esterendo-valeric acid 2-Bornyl valerate 2-Camphanyl valerate, endo- alpha -Terpinyl ester OF N-pentanoic acid Bornyl ester of n-pentanoic acid Bornyl pentanoate Bornyl valerate Bornyl valerianate Endo-1,7,7-trimethylbicyclo(2.2.1)hept-2-yl pentanoate endo-1,7,7-Trimethylbicyclo(2.2.1)hept-2-yl valerate Endo-2-camphanyl valerate FEMA 2164 Valeric acid, 2-bornyl ester, endo- C15H26O2 238.3657 238.193280076 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl pentanoate 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl pentanoate 7549-41-9 CCCCC(=O)OC1CC2CCC1(C)C2(C)C InChI=1S/C15H26O2/c1-5-6-7-13(16)17-12-10-11-8-9-15(12,4)14(11,2)3/h11-12H,5-10H2,1-4H3 ILUAVCBOWYHFAI-UHFFFAOYSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Carbonyl compounds Carboxylic acid esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homopolycyclic compound Bicyclic monoterpenoid Bornane monoterpenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 4.81 ALOGPS logs -4.45 ALOGPS solubility 8.36e-03 g/l ALOGPS logp 4.02 ChemAxon pka_strongest_basic -7 ChemAxon iupac 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl pentanoate ChemAxon average_mass 238.3657 ChemAxon mono_mass 238.193280076 ChemAxon smiles CCCCC(=O)OC1CC2CCC1(C)C2(C)C ChemAxon formula C15H26O2 ChemAxon inchi InChI=1S/C15H26O2/c1-5-6-7-13(16)17-12-10-11-8-9-15(12,4)14(11,2)3/h11-12H,5-10H2,1-4H3 ChemAxon inchikey ILUAVCBOWYHFAI-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 68.29 ChemAxon polarizability 28.85 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 23485 Specdb::CMs 28367 Specdb::CMs 101942 Specdb::CMs 172799 Specdb::MsMs 75717 Specdb::MsMs 75718 Specdb::MsMs 75719 Specdb::MsMs 135408 Specdb::MsMs 135409 Specdb::MsMs 135410 Specdb::MsMs 2455695 Specdb::MsMs 2455696 Specdb::MsMs 2455697 Specdb::MsMs 2480002 Specdb::MsMs 2480003 Specdb::MsMs 2480004 HMDB38247 #<Reference:0x00007f093c088918> berry camphor oak sawdust seedy spice vanilla woody