1.0 2010-04-08 22:13:13 UTC 2019-11-26 03:15:00 UTC FDB017654 Homoarecoline Isolated from betel nuts. Homoarecoline is found in nuts. Arecaidine ethyl ester Arecaidine-ethyl ester Ethyl 1-methyl-1,2,5,6-tetrahydronicotinate Homoarecoline Nicotinic acid, 1,2,5,6-tetrahydro-1-methyl-, ethyl ester C9H15NO2 169.2209 169.110278729 ethyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate ethyl 1-methyl-5,6-dihydro-2H-pyridine-3-carboxylate 28125-84-0 CCOC(=O)C1=CCCN(C)C1 InChI=1S/C9H15NO2/c1-3-12-9(11)8-5-4-6-10(2)7-8/h5H,3-4,6-7H2,1-2H3 UNARQANIGOBIHM-UHFFFAOYSA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aliphatic heteromonocyclic compounds Amino acids and derivatives Azacyclic compounds Carbonyl compounds Enoate esters Hydrocarbon derivatives Hydropyridines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Trialkylamines Aliphatic heteromonocyclic compound Alkaloid or derivatives Alpha,beta-unsaturated carboxylic ester Amine Amino acid or derivatives Azacycle Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enoate ester Hydrocarbon derivative Hydropyridine Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary aliphatic amine Tertiary amine logp 0.86 ALOGPS logs 0.24 ALOGPS solubility 2.97e+02 g/l ALOGPS logp 1.01 ChemAxon pka_strongest_basic 8.08 ChemAxon iupac ethyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate ChemAxon average_mass 169.2209 ChemAxon mono_mass 169.110278729 ChemAxon smiles CCOC(=O)C1=CCCN(C)C1 ChemAxon formula C9H15NO2 ChemAxon inchi InChI=1S/C9H15NO2/c1-3-12-9(11)8-5-4-6-10(2)7-8/h5H,3-4,6-7H2,1-2H3 ChemAxon inchikey UNARQANIGOBIHM-UHFFFAOYSA-N ChemAxon polar_surface_area 29.54 ChemAxon refractivity 48.61 ChemAxon polarizability 19.19 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18918 Specdb::CMs 159705 Specdb::MsIr 7897 Specdb::MsIr 7898 Specdb::MsMs 7847 Specdb::MsMs 7848 Specdb::MsMs 7849 Specdb::MsMs 14519 Specdb::MsMs 14520 Specdb::MsMs 14521 Specdb::MsMs 3040633 Specdb::MsMs 3040634 Specdb::MsMs 3040635 Specdb::MsMs 3103286 Specdb::MsMs 3103287 Specdb::MsMs 3103288 HMDB38321 #<Reference:0x000055ce33384580> Nuts Unknown generic