1.0 2010-04-08 22:13:23 UTC 2025-11-19 02:06:08 UTC FDB017898 Tuberin Isolated from violet potatoes. Tuberin is found in alcoholic beverages and potato. Tuberin ? C10H11NO2 177.203 177.078978598 N-[(E)-2-(4-methoxyphenyl)ethenyl]carboximidic acid N-[(E)-2-(4-methoxyphenyl)ethenyl]carboximidic acid [H]\C(N=CO)=C(\[H])C1=CC=C(OC)C=C1 InChI=1S/C10H11NO2/c1-13-10-4-2-9(3-5-10)6-7-11-8-12/h2-8H,1H3,(H,11,12)/b7-6+ SZCZSKMCTGEJKI-VOTSOKGWSA-N belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. Anisoles Organic compounds Benzenoids Phenol ethers Anisoles Aromatic homomonocyclic compounds Alkyl aryl ethers Carbonyl compounds Hydrocarbon derivatives Methoxybenzenes Organic oxides Organonitrogen compounds Organopnictogen compounds Phenoxy compounds Secondary carboxylic acid amides Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Ether Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenoxy compound Secondary carboxylic acid amide Styrene logp 2.31 ALOGPS logs -3.01 ALOGPS solubility 1.71e-01 g/l ALOGPS logp -0.73 ChemAxon pka_strongest_acidic -2.5 ChemAxon pka_strongest_basic 11.89 ChemAxon iupac N-[(E)-2-(4-methoxyphenyl)ethenyl]carboximidic acid ChemAxon average_mass 177.203 ChemAxon mono_mass 177.078978598 ChemAxon smiles [H]\C(N=CO)=C(\[H])C1=CC=C(OC)C=C1 ChemAxon formula C10H11NO2 ChemAxon inchi InChI=1S/C10H11NO2/c1-13-10-4-2-9(3-5-10)6-7-11-8-12/h2-8H,1H3,(H,11,12)/b7-6+ ChemAxon inchikey SZCZSKMCTGEJKI-VOTSOKGWSA-N ChemAxon polar_surface_area 41.82 ChemAxon refractivity 51.32 ChemAxon polarizability 19.19 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 99408 Specdb::MsMs 99409 Specdb::MsMs 99410 Specdb::MsMs 164547 Specdb::MsMs 164548 Specdb::MsMs 164549 Alcoholic beverages Unknown generic Potato Type 1 specific Solanum tuberosum 4113