1.0 2010-04-08 22:13:25 UTC 2019-11-26 03:15:29 UTC FDB017964 Lansiumamide A Isolated from seeds of Clausena lansium (wampee). Lansiumamide A is found in fruits. Lansiumamide A N-cis-Styrylcinnamamide C17H15NO 249.3071 249.115364107 (2E)-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide (2E)-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide 121817-36-5 O=C(N\C=C/C1=CC=CC=C1)\C=C\C1=CC=CC=C1 InChI=1S/C17H15NO/c19-17(12-11-15-7-3-1-4-8-15)18-14-13-16-9-5-2-6-10-16/h1-14H,(H,18,19)/b12-11+,14-13- DAZFHZLCFLDNPG-WCYNZMGESA-N belongs to the class of organic compounds known as cinnamic acid amides. These are amides of cinnamic acids. Cinnamic acid is an aromatic compound containing a benzene and a carboxylic acid group forming 3-phenylprop-2-enoic acid. Cinnamic acid amides Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Cinnamic acid amides Aromatic homomonocyclic compounds Carbonyl compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Styrenes Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Cinnamic acid amide Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide Styrene logp 3.66 ALOGPS logs -5.08 ALOGPS solubility 2.08e-03 g/l ALOGPS melting_point Mp 121-123° logp 3.66 ChemAxon pka_strongest_acidic 14.18 ChemAxon pka_strongest_basic -3.1 ChemAxon iupac (2E)-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide ChemAxon average_mass 249.3071 ChemAxon mono_mass 249.115364107 ChemAxon smiles O=C(N\C=C/C1=CC=CC=C1)\C=C\C1=CC=CC=C1 ChemAxon formula C17H15NO ChemAxon inchi InChI=1S/C17H15NO/c19-17(12-11-15-7-3-1-4-8-15)18-14-13-16-9-5-2-6-10-16/h1-14H,(H,18,19)/b12-11+,14-13- ChemAxon inchikey DAZFHZLCFLDNPG-WCYNZMGESA-N ChemAxon polar_surface_area 29.1 ChemAxon refractivity 79.24 ChemAxon polarizability 28.37 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 11577 Specdb::CMs 137027 Specdb::CMs 144761 Specdb::MsMs 43083 Specdb::MsMs 43084 Specdb::MsMs 43085 Specdb::MsMs 163422 Specdb::MsMs 163423 Specdb::MsMs 163424 Specdb::MsMs 2770511 Specdb::MsMs 2770512 Specdb::MsMs 2770513 Specdb::MsMs 2909001 Specdb::MsMs 2909002 Specdb::MsMs 2909003 HMDB38574 #<Reference:0x000055ce30e84410> Fruits Unknown generic