1.0 2010-04-08 22:13:28 UTC 2025-11-19 02:08:08 UTC FDB018044 (±)-Clausenamide Isolated from the leaves of Clausena lansium (wampee). (±)-Clausenamide is found in fruits. C18H19NO3 297.3484 297.136493479 3-hydroxy-5-[hydroxy(phenyl)methyl]-1-methyl-4-phenylpyrrolidin-2-one 3-hydroxy-5-[hydroxy(phenyl)methyl]-1-methyl-4-phenylpyrrolidin-2-one 103541-15-7 CN1C(C(O)C2=CC=CC=C2)C(C(O)C1=O)C1=CC=CC=C1 InChI=1S/C18H19NO3/c1-19-15(16(20)13-10-6-3-7-11-13)14(17(21)18(19)22)12-8-4-2-5-9-12/h2-11,14-17,20-21H,1H3 WGYGSZOQGYRGIP-UHFFFAOYSA-N belongs to the class of organic compounds known as phenylpyrrolidines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyrrolidine ring through a CC or CN bond. Pyrrolidine is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. Phenylpyrrolidines Organic compounds Organoheterocyclic compounds Pyrrolidines Phenylpyrrolidines Aromatic heteromonocyclic compounds Aromatic alcohols Azacyclic compounds Benzene and substituted derivatives Carbonyl compounds Hydrocarbon derivatives Lactams N-alkylpyrrolidines Organic oxides Organonitrogen compounds Organopnictogen compounds Pyrroles Pyrrolidine-2-ones Secondary alcohols Tertiary carboxylic acid amides 2-pyrrolidone 3-phenylpyrrolidine Alcohol Aromatic alcohol Aromatic heteromonocyclic compound Azacycle Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Hydrocarbon derivative Lactam Monocyclic benzene moiety N-alkylpyrrolidine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Pyrrolidone Secondary alcohol Tertiary carboxylic acid amide logp 1.67 ALOGPS logs -2.19 ALOGPS solubility 1.93e+00 g/l ALOGPS melting_point Mp 239-240° logp 1.47 ChemAxon pka_strongest_acidic 12.74 ChemAxon pka_strongest_basic -3.3 ChemAxon iupac 3-hydroxy-5-[hydroxy(phenyl)methyl]-1-methyl-4-phenylpyrrolidin-2-one ChemAxon average_mass 297.3484 ChemAxon mono_mass 297.136493479 ChemAxon smiles CN1C(C(O)C2=CC=CC=C2)C(C(O)C1=O)C1=CC=CC=C1 ChemAxon formula C18H19NO3 ChemAxon inchi InChI=1S/C18H19NO3/c1-19-15(16(20)13-10-6-3-7-11-13)14(17(21)18(19)22)12-8-4-2-5-9-12/h2-11,14-17,20-21H,1H3 ChemAxon inchikey WGYGSZOQGYRGIP-UHFFFAOYSA-N ChemAxon polar_surface_area 60.77 ChemAxon refractivity 83.36 ChemAxon polarizability 31.09 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 23965 Specdb::CMs 45952 Specdb::CMs 131336 Specdb::CMs 139070 Specdb::MsMs 10922 Specdb::MsMs 10923 Specdb::MsMs 10924 Specdb::MsMs 11165 Specdb::MsMs 11166 Specdb::MsMs 11167 Specdb::MsMs 17594 Specdb::MsMs 17595 Specdb::MsMs 17596 Specdb::MsMs 17837 Specdb::MsMs 17838 Specdb::MsMs 17839 Specdb::MsMs 2310153 Specdb::MsMs 2310154 Specdb::MsMs 2310155 Specdb::MsMs 2655464 Specdb::MsMs 2655465 Specdb::MsMs 2655466 HMDB0038649 Fruits Unknown generic