1.0 2010-04-08 22:13:42 UTC 2019-11-26 03:16:08 UTC FDB018419 (E)-Avenanthramide D Isolated from the oat Avena sativa. (E)-Avenanthramide D is found in oat and cereals and cereal products. C16H13NO4 283.2787 283.084457909 2-[(2Z)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid 2-[(2Z)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid OC(=O)C1=C(NC(=O)\C=C/C2=CC=C(O)C=C2)C=CC=C1 InChI=1S/C16H13NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-10,18H,(H,17,19)(H,20,21)/b10-7- INBHLTYBRKASIZ-YFHOEESVSA-N belongs to the class of organic compounds known as avenanthramides. These are a group of phenolic alkaloids consisting of conjugate of three phenylpropanoids (ferulic, caffeic, or p-coumaric acid) and anthranilic acid. Avenanthramides Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acylaminobenzoic acid and derivatives Anilides Benzoic acids Benzoyl derivatives Carbonyl compounds Carboxylic acids Coumaric acids and derivatives Hydrocarbon derivatives Monocarboxylic acids and derivatives N-arylamides N-cinnamoylanthranilic acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Styrenes Vinylogous amides 1-hydroxy-2-unsubstituted benzenoid Acylaminobenzoic acid or derivatives Anilide Aromatic homomonocyclic compound Avenanthramide Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Cinnamic acid amide Coumaric acid or derivatives Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety N-arylamide N-cinnamoylanthranilic acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Secondary carboxylic acid amide Styrene Vinylogous amide logp 3.17 ALOGPS logs -4.27 ALOGPS solubility 1.52e-02 g/l ALOGPS melting_point Mp 219° logp 3.57 ChemAxon pka_strongest_acidic 3.55 ChemAxon pka_strongest_basic -2 ChemAxon iupac 2-[(2Z)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid ChemAxon average_mass 283.2787 ChemAxon mono_mass 283.084457909 ChemAxon smiles OC(=O)C1=C(NC(=O)\C=C/C2=CC=C(O)C=C2)C=CC=C1 ChemAxon formula C16H13NO4 ChemAxon inchi InChI=1S/C16H13NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-10,18H,(H,17,19)(H,20,21)/b10-7- ChemAxon inchikey INBHLTYBRKASIZ-YFHOEESVSA-N ChemAxon polar_surface_area 86.63 ChemAxon refractivity 80.57 ChemAxon polarizability 28.58 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10399 Specdb::CMs 46165 Specdb::CMs 164449 Specdb::MsMs 82452 Specdb::MsMs 82453 Specdb::MsMs 82454 Specdb::MsMs 143817 Specdb::MsMs 143818 Specdb::MsMs 143819 Specdb::MsMs 3046366 Specdb::MsMs 3046367 Specdb::MsMs 3046368 Specdb::MsMs 3094165 Specdb::MsMs 3094166 Specdb::MsMs 3094167 HMDB38943 #<Reference:0x000055ce33620b90> Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic Oat Type 1 specific Avena sativa 4498