1.0 2010-04-08 22:13:42 UTC 2025-11-19 02:11:22 UTC FDB018420 Avenanthramide E Isolated from the oat Avena sativa. Avenanthramide E is found in oat and cereals and cereal products. Avenanthramide E N-Feruloylanthranilic acid C17H15NO5 313.3047 313.095022595 2-[(2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamido]benzoic acid 2-[(2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamido]benzoic acid 93755-77-2 COC1=C(O)C=CC(\C=C/C(=O)NC2=C(C=CC=C2)C(O)=O)=C1 InChI=1S/C17H15NO5/c1-23-15-10-11(6-8-14(15)19)7-9-16(20)18-13-5-3-2-4-12(13)17(21)22/h2-10,19H,1H3,(H,18,20)(H,21,22)/b9-7- FSKJPXSYWQUVGO-CLFYSBASSA-N belongs to the class of organic compounds known as avenanthramides. These are a group of phenolic alkaloids consisting of conjugate of three phenylpropanoids (ferulic, caffeic, or p-coumaric acid) and anthranilic acid. Avenanthramides Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acylaminobenzoic acid and derivatives Alkyl aryl ethers Anilides Anisoles Benzoic acids Benzoyl derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monocarboxylic acids and derivatives N-arylamides N-cinnamoylanthranilic acids Organic oxides Organopnictogen compounds Phenoxy compounds Secondary carboxylic acid amides Styrenes Vinylogous amides 1-hydroxy-2-unsubstituted benzenoid Acylaminobenzoic acid or derivatives Alkyl aryl ether Anilide Anisole Aromatic homomonocyclic compound Avenanthramide Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Cinnamic acid amide Ether Hydrocarbon derivative Methoxybenzene Methoxyphenol Monocarboxylic acid or derivatives Monocyclic benzene moiety N-arylamide N-cinnamoylanthranilic acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Phenol ether Phenoxy compound Secondary carboxylic acid amide Styrene Vinylogous amide logp 3.20 ALOGPS logs -4.47 ALOGPS solubility 1.07e-02 g/l ALOGPS melting_point Mp 235° logp 3.42 ChemAxon pka_strongest_acidic 3.55 ChemAxon pka_strongest_basic -2 ChemAxon iupac 2-[(2Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamido]benzoic acid ChemAxon average_mass 313.3047 ChemAxon mono_mass 313.095022595 ChemAxon smiles COC1=C(O)C=CC(\C=C/C(=O)NC2=C(C=CC=C2)C(O)=O)=C1 ChemAxon formula C17H15NO5 ChemAxon inchi InChI=1S/C17H15NO5/c1-23-15-10-11(6-8-14(15)19)7-9-16(20)18-13-5-3-2-4-12(13)17(21)22/h2-10,19H,1H3,(H,18,20)(H,21,22)/b9-7- ChemAxon inchikey FSKJPXSYWQUVGO-CLFYSBASSA-N ChemAxon polar_surface_area 95.86 ChemAxon refractivity 87.04 ChemAxon polarizability 30.96 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12654 Specdb::CMs 46166 Specdb::CMs 165649 Specdb::MsMs 59493 Specdb::MsMs 59494 Specdb::MsMs 59495 Specdb::MsMs 115638 Specdb::MsMs 115639 Specdb::MsMs 115640 Specdb::MsMs 3053102 Specdb::MsMs 3053103 Specdb::MsMs 3053104 Specdb::MsMs 3114239 Specdb::MsMs 3114240 Specdb::MsMs 3114241 HMDB0038944 Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic Oat Type 1 specific Avena sativa 4498