1.0 2010-04-08 22:13:44 UTC 2025-11-19 02:11:42 UTC FDB018476 Methyl oxindole-3-acetate Isolated from rice bran. Methyl oxindole-3-acetate is found in cereals and cereal products. Methyl oxindole-3-acetate C11H11NO3 205.2099 205.073893223 methyl 2-(2-hydroxy-3H-indol-3-yl)acetate methyl 2-(2-hydroxy-3H-indol-3-yl)acetate 61989-29-5 COC(=O)CC1C(O)=NC2=C1C=CC=C2 InChI=1S/C11H11NO3/c1-15-10(13)6-8-7-4-2-3-5-9(7)12-11(8)14/h2-5,8H,6H2,1H3,(H,12,14) OEGSDTIXVSKASM-UHFFFAOYSA-N belongs to the class of organic compounds known as indolyl carboxylic acids and derivatives. Indolyl carboxylic acids and derivatives are compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an indole ring. Indolyl carboxylic acids and derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolyl carboxylic acids and derivatives Aromatic heteropolycyclic compounds Azacyclic compounds Benzenoids Carbonyl compounds Hydrocarbon derivatives Indoles Indolines Lactams Methyl esters Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Carboxylic acid ester Dihydroindole Hydrocarbon derivative Indole Indolyl carboxylic acid derivative Lactam Methyl ester Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary carboxylic acid amide logp 1.58 ALOGPS logs -2.71 ALOGPS solubility 3.96e-01 g/l ALOGPS melting_point Mp 170-172° logp 1.61 ChemAxon pka_strongest_acidic 6.12 ChemAxon pka_strongest_basic 0.84 ChemAxon iupac methyl 2-(2-hydroxy-3H-indol-3-yl)acetate ChemAxon average_mass 205.2099 ChemAxon mono_mass 205.073893223 ChemAxon smiles COC(=O)CC1C(O)=NC2=C1C=CC=C2 ChemAxon formula C11H11NO3 ChemAxon inchi InChI=1S/C11H11NO3/c1-15-10(13)6-8-7-4-2-3-5-9(7)12-11(8)14/h2-5,8H,6H2,1H3,(H,12,14) ChemAxon inchikey OEGSDTIXVSKASM-UHFFFAOYSA-N ChemAxon polar_surface_area 58.89 ChemAxon refractivity 55.95 ChemAxon polarizability 20.96 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 49146 Specdb::MsMs 49147 Specdb::MsMs 49148 Specdb::MsMs 119661 Specdb::MsMs 119662 Specdb::MsMs 119663 Specdb::MsMs 3606353 Specdb::MsMs 3606354 Specdb::MsMs 3606355 Specdb::MsMs 3606356 Specdb::MsMs 3606357 Specdb::MsMs 3606358 Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic