1.0 2010-04-08 22:13:50 UTC 2025-11-19 02:13:01 UTC FDB018646 [4]-Gingerdiol [4]-gingerdiol is a member of the class of compounds known as gingerdiols. Gingerdiols are compounds containing a gingerdiol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-diol. [4]-gingerdiol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-gingerdiol can be found in ginger, which makes [4]-gingerdiol a potential biomarker for the consumption of this food product. 1-(4-Hydroxy-3-methoxyphenyl)-3,5-octanediol, 9CI C15H24O4 268.3487 268.167459256 1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol 1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol 53254-75-4 CCCC(O)CC(O)CCC1=CC(OC)=C(O)C=C1 InChI=1S/C15H24O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,12-13,16-18H,3-5,7,10H2,1-2H3 SVZGCYLXISBVQK-UHFFFAOYSA-N belongs to the class of organic compounds known as gingerdiols. Gingerdiols are compounds containing a gingerdiol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-diol. Gingerdiols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Fatty alcohols Hydrocarbon derivatives Methoxybenzenes Phenoxy compounds Secondary alcohols 1-hydroxy-2-unsubstituted benzenoid Alcohol Alkyl aryl ether Anisole Aromatic homomonocyclic compound Ether Fatty acyl Fatty alcohol Gingerdiol Hydrocarbon derivative Methoxybenzene Monocyclic benzene moiety Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Secondary alcohol logp 2.08 ALOGPS logs -2.59 ALOGPS solubility 6.86e-01 g/l ALOGPS logp 2.29 ChemAxon pka_strongest_acidic 10.28 ChemAxon pka_strongest_basic -2.7 ChemAxon iupac 1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol ChemAxon average_mass 268.3487 ChemAxon mono_mass 268.167459256 ChemAxon smiles CCCC(O)CC(O)CCC1=CC(OC)=C(O)C=C1 ChemAxon formula C15H24O4 ChemAxon inchi InChI=1S/C15H24O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,12-13,16-18H,3-5,7,10H2,1-2H3 ChemAxon inchikey SVZGCYLXISBVQK-UHFFFAOYSA-N ChemAxon polar_surface_area 69.92 ChemAxon refractivity 75.05 ChemAxon polarizability 30.61 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 99324 Specdb::MsMs 99325 Specdb::MsMs 99326 Specdb::MsMs 164454 Specdb::MsMs 164455 Specdb::MsMs 164456 Specdb::MsMs 3606362 Specdb::MsMs 3606363 Specdb::MsMs 3606364 Specdb::MsMs 3606365 Specdb::MsMs 3606366 Specdb::MsMs 3606367 Ginger Type 1 specific Zingiber officinale 94328