1.0 2010-04-08 22:07:44 UTC 2025-11-18 23:05:17 UTC FDB007712 1-(4-Hydroxy-3-methoxyphenyl)-3,5-diacetoxyoctane [4]-gingerdiol 3,5-diacetate is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. [4]-gingerdiol 3,5-diacetate is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-gingerdiol 3,5-diacetate can be found in herbs and spices, which makes [4]-gingerdiol 3,5-diacetate a potential biomarker for the consumption of this food product. C19H28O6 352.422 352.188588628 5-(acetyloxy)-1-(4-hydroxy-3-methoxyphenyl)octan-3-yl acetate 5-(acetyloxy)-1-(4-hydroxy-3-methoxyphenyl)octan-3-yl acetate CCCC(CC(CCC1=CC(OC)=C(O)C=C1)OC(C)=O)OC(C)=O InChI=1S/C19H28O6/c1-5-6-16(24-13(2)20)12-17(25-14(3)21)9-7-15-8-10-18(22)19(11-15)23-4/h8,10-11,16-17,22H,5-7,9,12H2,1-4H3 AUBPDZJRJKZQEX-UHFFFAOYSA-N belongs to the class of organic compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Methoxyphenols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acid esters Dicarboxylic acids and derivatives Hydrocarbon derivatives Methoxybenzenes Organic oxides Phenoxy compounds 1-hydroxy-2-unsubstituted benzenoid Alkyl aryl ether Anisole Aromatic homomonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Ether Hydrocarbon derivative Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound logp 3.17 ChemAxon pka_strongest_acidic 9.95 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 5-(acetyloxy)-1-(4-hydroxy-3-methoxyphenyl)octan-3-yl acetate ChemAxon average_mass 352.422 ChemAxon mono_mass 352.188588628 ChemAxon smiles CCCC(CC(CCC1=CC(OC)=C(O)C=C1)OC(C)=O)OC(C)=O ChemAxon formula C19H28O6 ChemAxon inchi InChI=1S/C19H28O6/c1-5-6-16(24-13(2)20)12-17(25-14(3)21)9-7-15-8-10-18(22)19(11-15)23-4/h8,10-11,16-17,22H,5-7,9,12H2,1-4H3 ChemAxon inchikey AUBPDZJRJKZQEX-UHFFFAOYSA-N ChemAxon polar_surface_area 82.06 ChemAxon refractivity 93.35 ChemAxon polarizability 38.31 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 4 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10251 Specdb::CMs 46275 Specdb::CMs 160993 Specdb::MsMs 6533 Specdb::MsMs 6534 Specdb::MsMs 6535 Specdb::MsMs 13205 Specdb::MsMs 13206 Specdb::MsMs 13207 Specdb::MsMs 2763844 Specdb::MsMs 2763845 Specdb::MsMs 2763846 Specdb::MsMs 2941103 Specdb::MsMs 2941104 Specdb::MsMs 2941105 HMDB0039132 Ginger Type 1 specific Zingiber officinale 94328