1.0 2010-04-08 22:13:55 UTC 2025-11-19 02:14:45 UTC FDB018773 Feruloyltartaric acid Feruloyltartaric acid, also known as trans-fertaric acid or feruloyltartarate, belongs to coumaric acids and derivatives class of compounds. Those are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Feruloyltartaric acid is practically insoluble (in water) and a moderately acidic compound (based on its pKa). Feruloyltartaric acid can be found in common grape, grape wine, sherry, and vinegar, which makes feruloyltartaric acid a potential biomarker for the consumption of these food products. 2-O-Feruloyl tartaric acid Fertaric acid Feruloyltartaric acid Monoferuloyltartaric acid C14H14O9 326.2556 326.063782046 (2R,3R)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid (2R,3R)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid 1044-65-1 COC1=C(O)C=CC(\C=C\C(=O)O[C@H]([C@@H](O)C(O)=O)C(O)=O)=C1 InChI=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+/t11-,12-/m1/s1 XIWXUSFCUBAMFH-WEPHUFDCSA-N belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha hydroxy acids and derivatives Anisoles Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Cinnamic acid esters Enoate esters Fatty acid esters Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monosaccharides Organic oxides Phenoxy compounds Secondary alcohols Styrenes Sugar acids and derivatives Tricarboxylic acids and derivatives 1-hydroxy-2-unsubstituted benzenoid Alcohol Alkyl aryl ether Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Anisole Aromatic homomonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Coumaric acid or derivatives Enoate ester Ether Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Methoxybenzene Methoxyphenol Monocyclic benzene moiety Monosaccharide Organic oxide Organic oxygen compound Organooxygen compound Phenol Phenol ether Phenoxy compound Secondary alcohol Styrene Sugar acid Tricarboxylic acid or derivatives aromatic ether cinnamate ester dicarboxylic acid phenols tetraric acid derivative logp 1.36 ALOGPS logs -2.71 ALOGPS solubility 6.39e-01 g/l ALOGPS melting_point Mp 175° dec. logp 0.74 ChemAxon pka_strongest_acidic 2.95 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac (2R,3R)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid ChemAxon average_mass 326.2556 ChemAxon mono_mass 326.063782046 ChemAxon smiles COC1=C(O)C=CC(\C=C\C(=O)O[C@H]([C@@H](O)C(O)=O)C(O)=O)=C1 ChemAxon formula C14H14O9 ChemAxon inchi InChI=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+/t11-,12-/m1/s1 ChemAxon inchikey XIWXUSFCUBAMFH-WEPHUFDCSA-N ChemAxon polar_surface_area 150.59 ChemAxon refractivity 74.23 ChemAxon polarizability 29.89 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 103911 Specdb::MsMs 103912 Specdb::MsMs 103913 Specdb::MsMs 170079 Specdb::MsMs 170080 Specdb::MsMs 170081 Specdb::MsMs 3606392 Specdb::MsMs 3606393 Specdb::MsMs 3606394 Specdb::MsMs 3606395 Specdb::MsMs 3606396 Specdb::MsMs 3606397 Common grape Type 1 specific Vitis vinifera 29760 0.031 0.030999998 0.030999998 mg/100 g Grape wine Type 2 specific 0.071 0.071000001 0.071000001 mg/100 g Sherry Type 2 specific 0.548 0.547999978 0.547999978 mg/100 g Vinegar Type 2 specific 0.102434 0.102433686 0.102433686 mg/100 g White wine Type 2 2.8 2.8 2.8 mg/100 g