1.0 2010-04-08 22:14:03 UTC 2019-11-26 03:16:56 UTC FDB018957 Methyl 2,6-dihydroxy-4-quinolinecarboxylate Alkaloid from the aleurone layer of rice Oryza sativa cv. heugjinmi. Methyl 2,6-dihydroxy-4-quinolinecarboxylate is found in cereals and cereal products. Methyl 2,6-dihydroxy-4-quinolinecarboxylate Methyl 2,6-dihydroxycinchoninate C11H9NO4 219.1935 219.053157781 methyl 2,6-dihydroxyquinoline-4-carboxylate methyl 2,6-dihydroxyquinoline-4-carboxylate 66416-75-9 COC(=O)C1=CC(O)=NC2=C1C=C(O)C=C2 InChI=1S/C11H9NO4/c1-16-11(15)8-5-10(14)12-9-3-2-6(13)4-7(8)9/h2-5,13H,1H3,(H,12,14) VMFVSNYOKIVXJO-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxyquinolines. Hydroxyquinolines are compounds containing a quinoline moiety bearing a hydroxyl group. Hydroxyquinolines Organic compounds Organoheterocyclic compounds Quinolines and derivatives Hydroxyquinolines Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Hydroquinolines Hydroquinolones Lactams Methyl esters Monocarboxylic acids and derivatives Organic oxides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Pyridinecarboxylic acids Pyridinones 1-hydroxy-2-unsubstituted benzenoid Aromatic heteropolycyclic compound Azacycle Benzenoid Carboxylic acid derivative Carboxylic acid ester Dihydroquinoline Dihydroquinolone Heteroaromatic compound Hydrocarbon derivative Hydroxyquinoline Lactam Methyl ester Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyridine Pyridine carboxylic acid Pyridine carboxylic acid or derivatives Pyridinone logp 2.15 ALOGPS logs -2.29 ALOGPS solubility 1.13e+00 g/l ALOGPS logp 2.12 ChemAxon pka_strongest_acidic 9.33 ChemAxon pka_strongest_basic 0.4 ChemAxon iupac methyl 2,6-dihydroxyquinoline-4-carboxylate ChemAxon average_mass 219.1935 ChemAxon mono_mass 219.053157781 ChemAxon smiles COC(=O)C1=CC(O)=NC2=C1C=C(O)C=C2 ChemAxon formula C11H9NO4 ChemAxon inchi InChI=1S/C11H9NO4/c1-16-11(15)8-5-10(14)12-9-3-2-6(13)4-7(8)9/h2-5,13H,1H3,(H,12,14) ChemAxon inchikey VMFVSNYOKIVXJO-UHFFFAOYSA-N ChemAxon polar_surface_area 79.65 ChemAxon refractivity 56.28 ChemAxon polarizability 21.25 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16938 Specdb::CMs 46392 Specdb::CMs 135327 Specdb::CMs 143061 Specdb::MsMs 89874 Specdb::MsMs 89875 Specdb::MsMs 89876 Specdb::MsMs 152904 Specdb::MsMs 152905 Specdb::MsMs 152906 Specdb::MsMs 2740669 Specdb::MsMs 2740670 Specdb::MsMs 2740671 Specdb::MsMs 2938003 Specdb::MsMs 2938004 Specdb::MsMs 2938005 HMDB39387 #<Reference:0x000055ce332cce80> Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic