1.0 2010-04-08 22:14:08 UTC 2019-11-26 03:17:06 UTC FDB019109 N-(4-Hydroxycinnamoyl)tyrosine Natural food antioxidant. Isolated from cocoa liquor (Theobroma cacao). N-(4-Hydroxycinnamoyl)tyrosine is found in cocoa and cocoa products and cocoa powder. N-(4-Hydroxycinnamoyl)-3-(4-hydroxyphenyl)alanine N-(4-Hydroxycinnamoyl)tyrosine N-[4'-Hydroxy-(E)-cinnamoyl]-L-tyrosine N-trans-p-Coumaroyltyrosine C18H17NO5 327.3313 327.110672659 3-(4-hydroxyphenyl)-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]propanoic acid 3-(4-hydroxyphenyl)-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]propanoic acid 77201-66-2 OC(=O)C(CC1=CC=C(O)C=C1)NC(=O)\C=C\C1=CC=C(O)C=C1 InChI=1S/C18H17NO5/c20-14-6-1-12(2-7-14)5-10-17(22)19-16(18(23)24)11-13-3-8-15(21)9-4-13/h1-10,16,20-21H,11H2,(H,19,22)(H,23,24)/b10-5+ LEEDEKWKJVUWGA-BJMVGYQFSA-N belongs to the class of organic compounds known as tyrosine and derivatives. Tyrosine and derivatives are compounds containing tyrosine or a derivative thereof resulting from reaction of tyrosine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Tyrosine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Amphetamines and derivatives Carbonyl compounds Carboxylic acids Cinnamic acid amides Coumaric acids and derivatives Hydrocarbon derivatives Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Phenylalanine and derivatives Phenylpropanoic acids Secondary carboxylic acid amides Styrenes 1-hydroxy-2-unsubstituted benzenoid 3-phenylpropanoic-acid Amphetamine or derivatives Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid Cinnamic acid amide Cinnamic acid or derivatives Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid or derivatives Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Phenylalanine or derivatives Secondary carboxylic acid amide Styrene Tyrosine or derivatives logp 2.35 ALOGPS logs -4.13 ALOGPS solubility 2.43e-02 g/l ALOGPS logp 2.65 ChemAxon pka_strongest_acidic 3.63 ChemAxon pka_strongest_basic 0.7 ChemAxon iupac 3-(4-hydroxyphenyl)-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]propanoic acid ChemAxon average_mass 327.3313 ChemAxon mono_mass 327.110672659 ChemAxon smiles OC(=O)C(CC1=CC=C(O)C=C1)NC(=O)\C=C\C1=CC=C(O)C=C1 ChemAxon formula C18H17NO5 ChemAxon inchi InChI=1S/C18H17NO5/c20-14-6-1-12(2-7-14)5-10-17(22)19-16(18(23)24)11-13-3-8-15(21)9-4-13/h1-10,16,20-21H,11H2,(H,19,22)(H,23,24)/b10-5+ ChemAxon inchikey LEEDEKWKJVUWGA-BJMVGYQFSA-N ChemAxon polar_surface_area 106.86 ChemAxon refractivity 88.94 ChemAxon polarizability 33.61 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 21338 Specdb::CMs 46436 Specdb::CMs 149869 Specdb::MsMs 48936 Specdb::MsMs 48937 Specdb::MsMs 48938 Specdb::MsMs 175902 Specdb::MsMs 175903 Specdb::MsMs 175904 Specdb::MsMs 2329011 Specdb::MsMs 2329012 Specdb::MsMs 2329013 Specdb::MsMs 2636113 Specdb::MsMs 2636114 Specdb::MsMs 2636115 HMDB39502 #<Reference:0x000055ce30ad7f38> Cocoa and cocoa products Unknown generic Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g