1.0 2010-04-08 22:14:09 UTC 2025-11-19 02:17:07 UTC FDB019127 4'-Dihydroabscisic acid Isolated from immature seeds of broad bean (Vicia faba). 4'-Dihydroabscisic acid is found in pulses. 4'-Dihydroabscisic acid C15H22O4 266.3328 266.151809192 (2E,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid (2E,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid 84026-26-6 C\C(\C=C\C1(O)C(C)=CC(O)CC1(C)C)=C/C(O)=O InChI=1S/C15H22O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,12,16,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7+ MWGXQVSTMXPXIW-WEYXYWBQSA-N belongs to the class of organic compounds known as abscisic acids and derivatives. These are terpene compounds containing the abscisic acid moiety, which is characterized by a 3-methylpenta-2,4-dienoic acid attached to the C1 carbon of a 4-oxocyclohex-2-ene moiety. Abscisic acids and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homomonocyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Hydroxy fatty acids Medium-chain fatty acids Methyl-branched fatty acids Monocarboxylic acids and derivatives Organic oxides Secondary alcohols Tertiary alcohols Unsaturated fatty acids Abscisic acid Alcohol Aliphatic homomonocyclic compound Branched fatty acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Hydroxy fatty acid Medium-chain fatty acid Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Secondary alcohol Tertiary alcohol Unsaturated fatty acid logp 1.39 ALOGPS logs -2.75 ALOGPS solubility 4.75e-01 g/l ALOGPS logp 1.68 ChemAxon pka_strongest_acidic 4.78 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac (2E,4E)-5-(1,4-dihydroxy-2,6,6-trimethylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid ChemAxon average_mass 266.3328 ChemAxon mono_mass 266.151809192 ChemAxon smiles C\C(\C=C\C1(O)C(C)=CC(O)CC1(C)C)=C/C(O)=O ChemAxon formula C15H22O4 ChemAxon inchi InChI=1S/C15H22O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,12,16,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7+ ChemAxon inchikey MWGXQVSTMXPXIW-WEYXYWBQSA-N ChemAxon polar_surface_area 77.76 ChemAxon refractivity 75.87 ChemAxon polarizability 28.94 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 48429 Specdb::MsMs 48430 Specdb::MsMs 48431 Specdb::MsMs 170814 Specdb::MsMs 170815 Specdb::MsMs 170816 Specdb::MsMs 2470305 Specdb::MsMs 2470306 Specdb::MsMs 2470307 Specdb::MsMs 2494802 Specdb::MsMs 2494803 Specdb::MsMs 2494804 Specdb::CMs 26005 Specdb::CMs 46445 Specdb::CMs 166795 HMDB39516 #<Reference:0x000055ce2daba0f8> Pulses Unknown generic