1.0 2010-04-08 22:14:09 UTC 2025-11-19 02:17:10 UTC FDB019132 N-(p-Hydroxyphenyl)ethyl p-hydroxycinnamide N-Trans-Coumaroyltyramine or N-(p-Hydroxyphenyl)ethyl p-hydroxycinnamide is also known as paprazine, N-trans-paprazine or trans-N-p-coumaroyl tyramine. It belongs to the class of organic compounds known as coumaric acids and derivatives. It is also classified as a hydroxycoumaric acid. Coumaric acids are aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. There are two isomers of paprazine, N-trans-paprazine and N-cis-paprazine. Paprazine is a neutral, hydrophobic molecule that is largely insoluble in water. N-(p-Hydroxyphenyl)ethyl p-hydroxycinnamide N-p-trans-Coumaroyltyramine Paprazine C17H17NO3 283.3218 283.120843415 (Z,2E)-3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enimidic acid (Z,2E)-3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enimidic acid 36417-86-4 OC1=CC=C(CCNC(=O)\C=C\C2=CC=C(O)C=C2)C=C1 InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+ RXGUTQNKCXHALN-BJMVGYQFSA-N belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Carbonyl compounds Cinnamic acid amides Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary carboxylic acid amides Styrenes 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid derivative Cinnamic acid amide Coumaric acid or derivatives Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Secondary carboxylic acid amide Styrene hydroxycinnamic acid logp 2.58 ALOGPS logs -4.26 ALOGPS solubility 1.57e-02 g/l ALOGPS melting_point Mp 260-261° logp 3.19 ChemAxon pka_strongest_acidic 4.56 ChemAxon pka_strongest_basic 6.52 ChemAxon iupac (Z,2E)-3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enimidic acid ChemAxon average_mass 283.3218 ChemAxon mono_mass 283.120843415 ChemAxon smiles OC1=CC=C(CCNC(=O)\C=C\C2=CC=C(O)C=C2)C=C1 ChemAxon formula C17H17NO3 ChemAxon inchi InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+ ChemAxon inchikey RXGUTQNKCXHALN-BJMVGYQFSA-N ChemAxon polar_surface_area 73.05 ChemAxon refractivity 83.63 ChemAxon polarizability 31.67 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 18964 Specdb::CMs 46446 Specdb::CMs 135258 Specdb::CMs 142992 Specdb::MsMs 51159 Specdb::MsMs 51160 Specdb::MsMs 51161 Specdb::MsMs 150444 Specdb::MsMs 150445 Specdb::MsMs 150446 Specdb::MsMs 2469912 Specdb::MsMs 2469913 Specdb::MsMs 2469914 Specdb::MsMs 2492645 Specdb::MsMs 2492646 Specdb::MsMs 2492647 HMDB0039521 Garden onion Type 1 specific Allium cepa 4679 Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 Green onion Type 1 Onion-family vegetables Unknown generic Pulses Unknown generic Red onion Type 1 Welsh onion Type 1 specific Allium fistulosum 35875