1.0 2010-04-08 22:14:13 UTC 2019-11-26 03:17:16 UTC FDB019229 3,4-Dimethyl-5-pentyl-2-furanheptanoic acid Component of F acid fraction present in beef blood serum. 3,4-Dimethyl-5-pentyl-2-furanheptanoic acid is found in animal foods. 8,11-Epoxy-9,10-dimethyl-8,10-hexadienoic acid F0 acid C18H30O3 294.429 294.219494826 7-(3,4-dimethyl-5-pentylfuran-2-yl)heptanoic acid 7-(3,4-dimethyl-5-pentylfuran-2-yl)heptanoic acid 92745-17-0 CCCCCC1=C(C)C(C)=C(CCCCCCC(O)=O)O1 InChI=1S/C18H30O3/c1-4-5-8-11-16-14(2)15(3)17(21-16)12-9-6-7-10-13-18(19)20/h4-13H2,1-3H3,(H,19,20) RFNALLFQILGKLF-UHFFFAOYSA-N belongs to the class of organic compounds known as furanoid fatty acids. These are fatty acids containing a 5-alkylfuran-2-alkanoic acid. Furanoid fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aromatic heteromonocyclic compounds Carbonyl compounds Carboxylic acids Furans Heteroaromatic compounds Hydrocarbon derivatives Medium-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Aromatic heteromonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Furan Furanoid fatty acid Heteroaromatic compound Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle logp 5.57 ALOGPS logs -4.73 ALOGPS solubility 5.49e-03 g/l ALOGPS logp 5.82 ChemAxon pka_strongest_acidic 4.58 ChemAxon pka_strongest_basic -1.1 ChemAxon iupac 7-(3,4-dimethyl-5-pentylfuran-2-yl)heptanoic acid ChemAxon average_mass 294.429 ChemAxon mono_mass 294.219494826 ChemAxon smiles CCCCCC1=C(C)C(C)=C(CCCCCCC(O)=O)O1 ChemAxon formula C18H30O3 ChemAxon inchi InChI=1S/C18H30O3/c1-4-5-8-11-16-14(2)15(3)17(21-16)12-9-6-7-10-13-18(19)20/h4-13H2,1-3H3,(H,19,20) ChemAxon inchikey RFNALLFQILGKLF-UHFFFAOYSA-N ChemAxon polar_surface_area 50.44 ChemAxon refractivity 86.47 ChemAxon polarizability 37.12 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22631 Specdb::CMs 46477 Specdb::CMs 136932 Specdb::CMs 144666 Specdb::MsMs 61383 Specdb::MsMs 61384 Specdb::MsMs 61385 Specdb::MsMs 117906 Specdb::MsMs 117907 Specdb::MsMs 117908 Specdb::MsMs 2286988 Specdb::MsMs 2286989 Specdb::MsMs 2286990 Specdb::MsMs 3082641 Specdb::MsMs 3082642 Specdb::MsMs 3082643 HMDB39603 #<Reference:0x000055ce321b0458>