1.0 2010-04-08 22:14:23 UTC 2015-07-21 06:36:18 UTC FDB019489 2-(5-Methyl-2-furanyl)piperidine Proline-derived Maillard product 2-Methyl-5-(2-piperidinyl)furan C10H15NO 165.2322 165.115364107 2-(5-methylfuran-2-yl)piperidine 2-(5-methylfuran-2-yl)piperidine 97073-18-2 CC1=CC=C(O1)C1CCCCN1 InChI=1S/C10H15NO/c1-8-5-6-10(12-8)9-4-2-3-7-11-9/h5-6,9,11H,2-4,7H2,1H3 PAHYJZIMPANAIV-UHFFFAOYSA-N belongs to the class of organic compounds known as aralkylamines. These are alkylamines in which the alkyl group is substituted at one carbon atom by an aromatic hydrocarbyl group. Aralkylamines Organic compounds Organic nitrogen compounds Organonitrogen compounds Amines Aromatic heteromonocyclic compounds Azacyclic compounds Dialkylamines Furans Heteroaromatic compounds Hydrocarbon derivatives Organooxygen compounds Organopnictogen compounds Oxacyclic compounds Piperidines Aralkylamine Aromatic heteromonocyclic compound Azacycle Furan Heteroaromatic compound Hydrocarbon derivative Organic oxygen compound Organoheterocyclic compound Organooxygen compound Organopnictogen compound Oxacycle Piperidine Secondary aliphatic amine Secondary amine logp 1.85 ALOGPS logs -2.85 ALOGPS solubility 2.33e-01 g/l ALOGPS logp 1.7 ChemAxon pka_strongest_basic 8.5 ChemAxon iupac 2-(5-methylfuran-2-yl)piperidine ChemAxon average_mass 165.2322 ChemAxon mono_mass 165.115364107 ChemAxon smiles CC1=CC=C(O1)C1CCCCN1 ChemAxon formula C10H15NO ChemAxon inchi InChI=1S/C10H15NO/c1-8-5-6-10(12-8)9-4-2-3-7-11-9/h5-6,9,11H,2-4,7H2,1H3 ChemAxon inchikey PAHYJZIMPANAIV-UHFFFAOYSA-N ChemAxon polar_surface_area 25.17 ChemAxon refractivity 48.66 ChemAxon polarizability 19.61 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 20082 Specdb::CMs 136064 Specdb::CMs 143798 Specdb::MsIr 8377 Specdb::MsIr 8378 Specdb::MsIr 8379 Specdb::MsMs 108195 Specdb::MsMs 108196 Specdb::MsMs 108197 Specdb::MsMs 175359 Specdb::MsMs 175360 Specdb::MsMs 175361 Specdb::MsMs 3043201 Specdb::MsMs 3043202 Specdb::MsMs 3043203 Specdb::MsMs 3097822 Specdb::MsMs 3097823 Specdb::MsMs 3097824 HMDB39836 #<Reference:0x000055ce318e1e80>