1.0 2010-04-08 22:14:25 UTC 2015-07-21 06:36:42 UTC FDB019532 2-Naphthyl anthranilate Flavouring ingredient for beverages, baked goods and candies 2-Aminobenzoyl 2-naphthalenol 2-Naphthalenol 2-aminobenzoate 2-Naphthalenol, 2-(2-aminobenzoate) 2-Naphthalenol, 2-aminobenzoate 2-Naphthalenol, 2-aminobenzoyl ester 2-Naphthyl anthranilate 2-Naphthyl o-aminobenzoate Anthranilic Acid, 2-naphthyl Ester Anthranilic acid, beta-naphthyl ester b-Naphthyl anthranilate beta-Naphthyl anthranilate FEMA 2767 C17H13NO2 263.2906 263.094628665 naphthalen-2-yl 2-aminobenzoate naphthalen-2-yl 2-aminobenzoate 63449-68-3 NC1=CC=CC=C1C(=O)OC1=CC2=CC=CC=C2C=C1 InChI=1S/C17H13NO2/c18-16-8-4-3-7-15(16)17(19)20-14-10-9-12-5-1-2-6-13(12)11-14/h1-11H,18H2 YJFCKXVXEKHSEC-UHFFFAOYSA-N belongs to the class of organic compounds known as naphthalenes. Naphthalenes are compounds containing a naphthalene moiety, which consists of two fused benzene rings. Naphthalenes Organic compounds Benzenoids Naphthalenes Aromatic homopolycyclic compounds Amino acids and derivatives Aminobenzoic acids and derivatives Aniline and substituted anilines Benzoic acid esters Benzoyl derivatives Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Primary amines Vinylogous amides Amine Amino acid or derivatives Aminobenzoic acid or derivatives Aniline or substituted anilines Aromatic homopolycyclic compound Benzoate ester Benzoic acid or derivatives Benzoyl Carboxylic acid derivative Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Naphthalene Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary amine Vinylogous amide logp 4.04 ALOGPS logs -5.19 ALOGPS solubility 1.70e-03 g/l ALOGPS melting_point Mp 118° logp 4.45 ChemAxon pka_strongest_acidic 19.29 ChemAxon pka_strongest_basic 2.07 ChemAxon iupac naphthalen-2-yl 2-aminobenzoate ChemAxon average_mass 263.2906 ChemAxon mono_mass 263.094628665 ChemAxon smiles NC1=CC=CC=C1C(=O)OC1=CC2=CC=CC=C2C=C1 ChemAxon formula C17H13NO2 ChemAxon inchi InChI=1S/C17H13NO2/c18-16-8-4-3-7-15(16)17(19)20-14-10-9-12-5-1-2-6-13(12)11-14/h1-11H,18H2 ChemAxon inchikey YJFCKXVXEKHSEC-UHFFFAOYSA-N ChemAxon polar_surface_area 52.32 ChemAxon refractivity 79.01 ChemAxon polarizability 28.48 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12435 Specdb::CMs 136275 Specdb::CMs 144009 Specdb::MsMs 49911 Specdb::MsMs 49912 Specdb::MsMs 49913 Specdb::MsMs 134505 Specdb::MsMs 134506 Specdb::MsMs 134507 Specdb::MsMs 2253374 Specdb::MsMs 2257073 Specdb::MsMs 2257534 Specdb::MsMs 2259072 Specdb::MsMs 2259477 Specdb::MsMs 2449843 Specdb::MsMs 2449844 Specdb::MsMs 2449845 Specdb::MsMs 2485980 Specdb::MsMs 2485981 Specdb::MsMs 2485982 HMDB39873 #<Reference:0x000055ce32254a08> floral grape neroli