1.0 2010-04-08 22:14:25 UTC 2025-11-19 02:20:28 UTC FDB019541 Sodium alginate Stabiliser, emulsifier, thickener, formulation aid [DFC] The chemical compound sodium alginate is the sodium salt of alginic acid. Sodium alginate is a gum, extracted from the cell walls of brown algae. As a flavorless gum, it is used by the foods industry to increase viscosity and as an emulsifier. As a food additive, sodium alginate is used especially in the production of gel-like foods. For example, bakers' "Chellies" are often gelled alginate "jam." [Wikipedia] Algin E401 Sodium alginate C6H9NaO7 216.1212 216.024597317 sodium 3,4,5,6-tetrahydroxyoxane-2-carboxylate sodium 3,4,5,6-tetrahydroxyoxane-2-carboxylate 9005-38-3 [Na+].OC1OC(C(O)C(O)C1O)C([O-])=O InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1 MSXHSNHNTORCAW-UHFFFAOYSA-M belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Glucuronic acid derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aliphatic heteromonocyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid salts Carboxylic acids Hemiacetals Hydrocarbon derivatives Monocarboxylic acids and derivatives Monosaccharides Organic oxides Organic sodium salts Oxacyclic compounds Oxanes Polyols Pyrans Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid salt Glucuronic acid or derivatives Hemiacetal Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives Monosaccharide Organic alkali metal salt Organic oxide Organic salt Organic sodium salt Organoheterocyclic compound Oxacycle Oxane Polyol Pyran Secondary alcohol solid logp -1.86 ALOGPS logs 0.56 ALOGPS solubility 7.82e+02 g/l ALOGPS logp -2.6 ChemAxon pka_strongest_acidic 3.21 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac sodium 3,4,5,6-tetrahydroxyoxane-2-carboxylate ChemAxon average_mass 216.1212 ChemAxon mono_mass 216.024597317 ChemAxon smiles [Na+].OC1OC(C(O)C(O)C1O)C([O-])=O ChemAxon formula C6H9NaO7 ChemAxon inchi InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1 ChemAxon inchikey MSXHSNHNTORCAW-UHFFFAOYSA-M ChemAxon polar_surface_area 130.28 ChemAxon refractivity 46.63 ChemAxon polarizability 15.89 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 7 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1230865 Specdb::MsMs 1230866 Specdb::MsMs 1230867 Specdb::MsMs 1346410 Specdb::MsMs 1346411 Specdb::MsMs 1346412 odorless