1.0 2010-04-08 22:14:28 UTC 2025-11-19 02:22:22 UTC FDB019629 Niazimicin B Constituent of Moringa oleifera (horseradish tree). Niazimicin B is found in fats and oils, herbs and spices, and green vegetables. Niazimicin B C16H23NO6S 357.422 357.124608163 N-({4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}methyl)ethoxycarbothioamide N-({4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}methyl)ethoxycarbothioamide 147821-49-6 CCOC(=S)NCC1=CC=C(OC2OC(C)C(O)C(O)C2O)C=C1 InChI=1S/C16H23NO6S/c1-3-21-16(24)17-8-10-4-6-11(7-5-10)23-15-14(20)13(19)12(18)9(2)22-15/h4-7,9,12-15,18-20H,3,8H2,1-2H3,(H,17,24) JOSHUAQJVMGTGS-UHFFFAOYSA-N belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Phenolic glycosides Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic heteromonocyclic compounds Acetals Hexoses Hydrocarbon derivatives O-glycosyl compounds Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Oxanes Phenol ethers Phenoxy compounds Polyols Secondary alcohols Thiocarbamic acid esters Acetal Alcohol Aromatic heteromonocyclic compound Benzenoid Hexose monosaccharide Hydrocarbon derivative Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic nitrogen compound Organoheterocyclic compound Organonitrogen compound Organopnictogen compound Organosulfur compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Secondary alcohol Thiocarbamic acid derivative Thiocarbamic acid ester logp 1.05 ALOGPS logs -2.94 ALOGPS solubility 4.06e-01 g/l ALOGPS logp 1.26 ChemAxon pka_strongest_acidic 8.69 ChemAxon pka_strongest_basic -3.6 ChemAxon iupac N-({4-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]phenyl}methyl)ethoxycarbothioamide ChemAxon average_mass 357.422 ChemAxon mono_mass 357.124608163 ChemAxon smiles CCOC(=S)NCC1=CC=C(OC2OC(C)C(O)C(O)C2O)C=C1 ChemAxon formula C16H23NO6S ChemAxon inchi InChI=1S/C16H23NO6S/c1-3-21-16(24)17-8-10-4-6-11(7-5-10)23-15-14(20)13(19)12(18)9(2)22-15/h4-7,9,12-15,18-20H,3,8H2,1-2H3,(H,17,24) ChemAxon inchikey JOSHUAQJVMGTGS-UHFFFAOYSA-N ChemAxon polar_surface_area 100.41 ChemAxon refractivity 90.92 ChemAxon polarizability 37.32 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 16368 Specdb::CMs 42679 Specdb::MsMs 85266 Specdb::MsMs 85267 Specdb::MsMs 85268 Specdb::MsMs 147339 Specdb::MsMs 147340 Specdb::MsMs 147341 HMDB31944 #<Reference:0x000055ce30be5ad8> Fats and oils Unknown generic Green vegetables Unknown generic Herbs and Spices Unknown generic